Home
Class 12
CHEMISTRY
IUPAC name of the following compound is ...

IUPAC name of the following compound is
`CH_(3)-CH=CH-CH_(2)-C-=CH`

A

Hex-2-en-5-yne

B

Hex-5-yn-2-ene

C

Hex-4-en-1-yne

D

Hex-1-yn-4-ene

Text Solution

AI Generated Solution

The correct Answer is:
To determine the IUPAC name of the compound `CH₃-CH=CH-CH₂-C≡CH`, we can follow these steps: ### Step 1: Identify the longest carbon chain First, we need to identify the longest continuous carbon chain in the compound. In this case, the longest chain consists of 6 carbon atoms. ### Step 2: Number the carbon chain Next, we need to number the carbon chain. We will start numbering from the end that gives the lowest numbers to the multiple bonds (double and triple bonds). - If we number from the left (starting from CH₃), we get: 1. CH₃ 2. CH 3. CH 4. CH₂ 5. C 6. C This gives the double bond at position 3 and the triple bond at position 5. - If we number from the right (starting from C≡CH), we get: 1. C 2. CH₂ 3. CH 4. CH 5. CH₃ This gives the triple bond at position 1 and the double bond at position 4. Since we prefer the numbering that gives the lowest locants to the multiple bonds, we will start from the right. ### Step 3: Identify the types of bonds In this compound, we have: - A double bond (alkene) at position 4. - A triple bond (alkyne) at position 1. ### Step 4: Construct the name According to IUPAC nomenclature: - The base name is derived from the longest carbon chain, which has 6 carbons, so it is "hex". - The presence of a triple bond (alkyne) takes precedence over the double bond (alkene) in naming, so we will indicate the triple bond first. - The double bond will be indicated with the suffix "ene". Thus, we will have: - "hex" for the 6 carbon atoms. - "1-yne" for the triple bond at position 1. - "4-ene" for the double bond at position 4. ### Step 5: Combine the elements Combining these, we get the final IUPAC name as: **Hex-4-ene-1-yne** ### Final Answer The IUPAC name of the compound `CH₃-CH=CH-CH₂-C≡CH` is **Hex-4-ene-1-yne**. ---
Promotional Banner

Topper's Solved these Questions

  • CHEMISTRY AT A GLANCE

    ALLEN|Exercise INORGANIC CHEMISTRY|300 Videos
  • Chemical Equilibrium

    ALLEN|Exercise All Questions|30 Videos
  • ELECTROCHEMISTRY

    ALLEN|Exercise EXERCISE -05 [B]|38 Videos

Similar Questions

Explore conceptually related problems

The IUPAC name of the following compound is : {:(CH_(3)-CH_(2)-CH-CH_(2)-CH-CH_(2)-CH_(3)),(" | |"),(" "CH_(2)-CH_(3)" "CH_(3)):}

The IUPAC name of the following compound is (CH_(3))_(2)CH-CH_(2)CH=CH-CH=CH-underset(C_(2)H_(5))underset(|)CH-CH_(3)

Give the IUPAC names of the following compounds : CH_(3)CH(CH_(3))CH_(2)CH_(2)CHO

Give the IUPAC names of the following compounds : CH_(3)CH_(2)COCH_(2)C(CH_(3))_(3)

Write IUPAC names of the following compounds : CH_(3)CH=C(CH_(3))_(2)

ALLEN-CHEMISTRY AT A GLANCE-ORGANIC CHEMISTRY
  1. IUPAC Name of the given compound CH(3)-underset(O)underset(||)(C)-C...

    Text Solution

    |

  2. IUPAC Name for given compound : CH(3)-underset(CH(3))underset(|)(CH...

    Text Solution

    |

  3. IUPAC name of the following compound is CH(3)-CH=CH-CH(2)-C-=CH

    Text Solution

    |

  4. IUPAC name of given compound is

    Text Solution

    |

  5. Which of the following IUPAC name is incorrect

    Text Solution

    |

  6. Number of carbon in parent carbon chain in the following compound

    Text Solution

    |

  7. The correct IUPAC name of following compound is :

    Text Solution

    |

  8. IUPAC name of CH(3)-underset(CH(3))underset(|)(CH)-CH(2)-underset(CH(3...

    Text Solution

    |

  9. The IUPAC name for the compound

    Text Solution

    |

  10. One among the following is the correct IUPAC name for the compound C...

    Text Solution

    |

  11. The correct IUPAC name of HOOC-underset(COOH)underset(|)(CH)-COOH is

    Text Solution

    |

  12. The IUPAC name of the compound

    Text Solution

    |

  13. The correct IUPAC name of the H-overset(O)overset(||)C-overset(O)overs...

    Text Solution

    |

  14. How many cyclic structural isomer of C(5)H(10) are possible

    Text Solution

    |

  15. Among these chain isomers are : (I) CH(3)-CH(3)-CH(2)-CH(2)-OH (II...

    Text Solution

    |

  16. Tautomer of I is

    Text Solution

    |

  17. Draw the structural formulae of all the possible isomers of the compou...

    Text Solution

    |

  18. The total number of cyclic isomers possible for a hydrocarbon with the...

    Text Solution

    |

  19. The number of structural isomers possible from the molecular formula C...

    Text Solution

    |

  20. The number of isomeric carboxylic acids and esters possible for the fo...

    Text Solution

    |