Home
Class 12
MATHS
(1+sin 2theta+cos 2theta)/(1+sin2 theta-...

`(1+sin 2theta+cos 2theta)/(1+sin2 theta-cos 2 theta)`=

A

`(1)/(2)tan theta`

B

`(1)/(2)cot theta`

C

`tan theta`

D

`cot theta`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the expression \((1 + \sin 2\theta + \cos 2\theta) / (1 + \sin 2\theta - \cos 2\theta)\), we will use trigonometric identities to simplify it step by step. ### Step 1: Substitute the identities We know that: \[ \sin 2\theta = 2\sin \theta \cos \theta \] \[ \cos 2\theta = \cos^2 \theta - \sin^2 \theta \] Substituting these identities into the expression gives us: \[ \frac{1 + 2\sin \theta \cos \theta + (\cos^2 \theta - \sin^2 \theta)}{1 + 2\sin \theta \cos \theta - (\cos^2 \theta - \sin^2 \theta)} \] ### Step 2: Simplify the numerator Now, let's simplify the numerator: \[ 1 + 2\sin \theta \cos \theta + \cos^2 \theta - \sin^2 \theta \] We can express \(1\) as \(\sin^2 \theta + \cos^2 \theta\): \[ \sin^2 \theta + \cos^2 \theta + 2\sin \theta \cos \theta + \cos^2 \theta - \sin^2 \theta \] This simplifies to: \[ 2\cos^2 \theta + 2\sin \theta \cos \theta \] ### Step 3: Simplify the denominator Now, let's simplify the denominator: \[ 1 + 2\sin \theta \cos \theta - (\cos^2 \theta - \sin^2 \theta) \] Again, substituting \(1\) as \(\sin^2 \theta + \cos^2 \theta\): \[ \sin^2 \theta + \cos^2 \theta + 2\sin \theta \cos \theta - \cos^2 \theta + \sin^2 \theta \] This simplifies to: \[ 2\sin^2 \theta + 2\sin \theta \cos \theta \] ### Step 4: Rewrite the expression Now we can rewrite our expression: \[ \frac{2\cos^2 \theta + 2\sin \theta \cos \theta}{2\sin^2 \theta + 2\sin \theta \cos \theta} \] ### Step 5: Factor out common terms We can factor out \(2\) from both the numerator and the denominator: \[ \frac{2(\cos^2 \theta + \sin \theta \cos \theta)}{2(\sin^2 \theta + \sin \theta \cos \theta)} \] This simplifies to: \[ \frac{\cos^2 \theta + \sin \theta \cos \theta}{\sin^2 \theta + \sin \theta \cos \theta} \] ### Step 6: Final simplification Now, we can express this as: \[ \frac{\cos^2 \theta + \sin \theta \cos \theta}{\sin^2 \theta + \sin \theta \cos \theta} \] This is the simplified form of the original expression. ### Final Answer Thus, the value of the expression \(\frac{1 + \sin 2\theta + \cos 2\theta}{1 + \sin 2\theta - \cos 2\theta}\) is: \[ \frac{\cos^2 \theta + \sin \theta \cos \theta}{\sin^2 \theta + \sin \theta \cos \theta} \]
Promotional Banner

Topper's Solved these Questions

Similar Questions

Explore conceptually related problems

(1+sin2theta+cos2theta)/(1+sin2theta-cos2theta) =

(sin2 theta)/(1-cos2 theta)

(1+sin2 theta-cos2 theta)/(1+sin2 theta+cos2 theta)=tan theta

Prove that: (i) (1+"sin" 2theta-cos 2theta)/(1+"sin" 2theta+cos 2theta)="tan" theta . (ii) 2 tan 2x=(cos x+"sin" x)/(cos x-"sin" x)-(cos x-"sin" x)/(cos x+"sin" x) .

Prove that: (a) (sin 2 theta)/(1+cos 2 theta)=tan theta (b) (1+sin 2 theta+2theta)/(1+sin2 theta-cos 2 theta)=cot theta

Prove that: a) (sin2theta)/(1+cos2theta) = tantheta b) (1+sin2theta+cos2theta)/(1+sin2theta-cos2theta)=cottheta

Prove each of the following identities : (i) (sin theta - cos theta)/(sin theta + cos theta) + ( sin theta+ cos theta)/(sin theta - cos theta) = (2)/((2 sin^(2) theta -1)) (ii) (sin theta + cos theta ) /(sin theta - cos theta) + ( sin theta - cos theta) /(sin theta + cos theta) = (2) /((1- 2 cos^(2) theta))

(sin2 theta)/(1+cos2 theta)=

((1 + sin theta-cos theta) / (1 + sin theta + cos theta)) ^ (2) = (1-cos theta) / (1 + cos theta)

Prove that : (1+sin2 theta-cos 2theta)/(sin theta+cos theta)=2sin theta

ALLEN-COMPOUND ANGLES-EX-01
  1. if sin x + sin^2 x = 1, then the value of cos^2 x + cos^4x is

    Text Solution

    |

  2. 2(sin^6theta+cos^6theta)-3(sin^4theta+cos^4theta) is equal to 0 (b) 1 ...

    Text Solution

    |

  3. cos^2 48^0-sin^2 12^0 is equal to

    Text Solution

    |

  4. The expression (sin 8thetacos theta-sin6 thetacos 3 theta)/(cos 2 thet...

    Text Solution

    |

  5. If 3 sin alpha=5 sin beta, then (tan((alpha+beta)/2))/(tan ((alpha-bet...

    Text Solution

    |

  6. (sin(A-C)+2sinA+sin(A+C))/(sin(B-C)+2sinB+sin(B+C)) is equal to

    Text Solution

    |

  7. (1+sin 2theta+cos 2theta)/(1+sin2 theta-cos 2 theta)=

    Text Solution

    |

  8. If A=tan6^(@) tan 42^(@) and B= cot 66^(@)cot 78^(@) then-

    Text Solution

    |

  9. If x=ycos((2pi)/3)=zcos((4pi)/3), then xy+yz+zx=

    Text Solution

    |

  10. If tanalpha=(1+2^(-x))^(-1), tan beta=(1+2^(x+1))^(-1), then alpha+bet...

    Text Solution

    |

  11. If tanA+tanB+tanC=tanAtanBtanC then

    Text Solution

    |

  12. The value of sin10^@+sin20^@+sin30^@...+sin360^@ is equal to -

    Text Solution

    |

  13. The number of real solutions of the equation sin(e^x)=2^x+2^(-x) is

    Text Solution

    |

  14. If f(x)=sin(3x)/sin x,x!=npi, then the range of values of f(x) for ...

    Text Solution

    |

  15. If cosx+cosy+cosalpha=0 and sinx+siny+sinalpha=0 then cot((x+y)/2)=

    Text Solution

    |

  16. The value of sin(pi/14)sin((3pi)/14)sin((5pi)/14) is

    Text Solution

    |

  17. 18.. Maximum and minimum value of 2sin^2theta-3sintheta+2 is

    Text Solution

    |

  18. For theta in(0,pi/2) , the maximum value of sin(theta+pi/6)+cos(theta+...

    Text Solution

    |

  19. Minimum value of the expression cos^2theta-(6 sintheta cos theta) + 3 ...

    Text Solution

    |