How many stereoisomers can be drawn for the following molecule?
`H_(3)"CCH"_(2)CH=CHCH_(2)CH(Cl)CH_(3)`

Answer

To determine the number of stereoisomers for the molecule `H3C-CH2-CH=CH-CH2-CH(Cl)-CH3`, we will follow these steps:

### Step 1: Identify the Structure
The given molecule can be represented as:
- CH3-CH2-CH=CH-CH2-CH(Cl)-CH3

### Step 2: Identify Chiral Centers
A chiral center (or asymmetric carbon) is a carbon atom that is bonded to four different groups. In the given molecule, we need to identify if there are any chiral centers.

The structure has the following carbon atoms:
1. C1: CH3
2. C2: CH2
3. C3: CH (part of the double bond)
4. C4: CH (part of the double bond)
5. C5: CH2
6. C6: CH(Cl)

The carbon at C6 is a chiral center because it is bonded to four different groups:
- Cl
- CH3
- CH2 (from the left)
- CH (from the double bond)

### Step 3: Count Chiral Centers
From our analysis, we found 1 chiral center (C6).

### Step 4: Calculate Optical Isomers
The number of optical isomers can be calculated using the formula:
\[ \text{Number of optical isomers} = 2^n \]
where \( n \) is the number of chiral centers.

Since we have 1 chiral center:
\[ \text{Number of optical isomers} = 2^1 = 2 \]

### Step 5: Identify Double Bonds for Geometric Isomers
Next, we need to check for geometric isomerism due to the presence of double bonds. The double bond between C3 and C4 can have cis and trans configurations.

### Step 6: Count Geometric Isomers
For the double bond (C3=C4), we can have:
- Cis isomer (where the higher priority groups are on the same side)
- Trans isomer (where the higher priority groups are on opposite sides)

Thus, we have 2 geometric isomers.

### Step 7: Total Number of Stereoisomers
The total number of stereoisomers is the product of the number of optical isomers and the number of geometric isomers:
\[ \text{Total stereoisomers} = (\text{Number of optical isomers}) \times (\text{Number of geometric isomers}) \]
\[ \text{Total stereoisomers} = 2 \times 2 = 4 \]

### Final Answer
The total number of stereoisomers for the given molecule is **4**.

---