How many different stereoisomers are possible for the following compound ?
`CHBr=HC-underset(Cl)underset(|)overset(H)overset(|)(C)-CH=CHCl`

Options

A. 1
B. 2
C. 3
D. 4

Explanation

To determine the number of different stereoisomers for the given compound `CHBr=HC(Cl)(H)(C)-CH=CHCl`, we can follow these steps:

### Step 1: Identify the Stereocenters
First, we need to identify the stereocenters (chiral centers) in the compound. A stereocenter is typically a carbon atom that is bonded to four different groups.

In the given compound, we can identify the following chiral centers:
- The carbon atom connected to `Cl`, `H`, and the rest of the carbon chain (C).
- The carbon atom involved in the double bond with `Br` and `H`.

### Step 2: Count the Stereocenters
From the structure, we can see that there are **3 stereocenters**:
1. The first chiral carbon (C) bonded to `Cl`, `H`, and the carbon chain.
2. The second chiral carbon (C) in the double bond.
3. The third chiral carbon (C) in the chain.

### Step 3: Apply the Formula for Stereoisomers
The formula to calculate the number of stereoisomers for a compound with `n` stereocenters is given by:
\[ \text{Number of stereoisomers} = 2^n \]

### Step 4: Calculate the Number of Stereoisomers
Substituting the number of stereocenters into the formula:
\[ \text{Number of stereoisomers} = 2^3 = 8 \]

### Conclusion
Thus, the total number of different stereoisomers possible for the compound `CHBr=HC(Cl)(H)(C)-CH=CHCl` is **8**.

---