`2,3-`Dimethyl`-2-`butene can be prepared by heating which of the following compounds with a strong acid ?

Options

A. `(CH_(3))_(2)C=CH-CH_(2)-CH_(3)`
B. `(CH_(3))_(2)CH-CH_(2)-CH=CH_(2)`
C.
D. `(CH_(3))_(3)C-CH=CH_(2)`

Explanation

To prepare 2,3-Dimethyl-2-butene by heating a compound with a strong acid, we need to analyze the given compounds and determine which one can lead to the desired product through carbocation rearrangement.

### Step-by-Step Solution:

1. **Identify the Structure of 2,3-Dimethyl-2-butene:**
- The molecular formula for 2,3-Dimethyl-2-butene is C6H12.
- The structure can be drawn as follows:
```
CH3
|
CH3-C=CH-CH3
|
CH3
```

2. **Analyze the Given Compounds:**
- We need to evaluate each of the four compounds provided to see which can yield 2,3-Dimethyl-2-butene when treated with a strong acid.

3. **Examine Each Compound:**
- **Compound 1:** CH3-CH(CH3)-C(CH3)=CH2
- When heated with a strong acid, this compound can form a stable tertiary carbocation. However, it does not rearrange to form 2,3-Dimethyl-2-butene.

- **Compound 2:** CH3-CH2-CH(CH3)-CH2-CH3
- This compound can also form a secondary carbocation. However, it does not lead to the formation of the desired product.

- **Compound 3:** CH3-CH2-CH(CH3)-C(CH3)=CH2
- This compound can form a carbocation that can rearrange, but it results in a structure that has more than six carbons, which does not match 2,3-Dimethyl-2-butene.

- **Compound 4:** CH3-CH(CH3)-C(CH3)=CH2
- This compound can form a tertiary carbocation upon heating with a strong acid. The rearrangement of this carbocation can lead to the formation of 2,3-Dimethyl-2-butene.

4. **Conclusion:**
- After analyzing all four compounds, **Compound 4** is the one that can be heated with a strong acid to yield 2,3-Dimethyl-2-butene.

### Final Answer:
**The correct compound that can be heated with a strong acid to prepare 2,3-Dimethyl-2-butene is Compound 4.**