Home
Class 12
CHEMISTRY
Cyclohexene on raction with cold dilute ...

Cyclohexene on raction with cold dilute `KMnO_(4)` solutioon gives

A

`(+-)-`trans`-1,2`-cyclohexanediol

B

`1,2-`cyclohexanediol

C

cis`-1,2-`cyclohexanediol

D

trans`-1,2-cyclohexanediol

Text Solution

AI Generated Solution

The correct Answer is:
To solve the question regarding the reaction of cyclohexene with cold dilute KMnO4, we can follow these steps: ### Step 1: Identify the Reactants We start with cyclohexene, which is an alkene with the molecular formula C6H10. It has a double bond between two carbon atoms in a six-membered ring. **Hint:** Remember that cyclohexene is a cyclic compound with a double bond, which makes it reactive towards certain reagents. ### Step 2: Understand the Reaction Conditions The reaction is carried out with cold dilute KMnO4. KMnO4 is known for its ability to perform syn-dihydroxylation of alkenes. This means that it adds hydroxyl (OH) groups across the double bond in a syn fashion (on the same side). **Hint:** Syn-dihydroxylation results in the addition of two hydroxyl groups to the same side of the double bond. ### Step 3: Perform the Reaction When cyclohexene reacts with cold dilute KMnO4, the double bond opens up, and two hydroxyl groups are added to the carbons that were involved in the double bond. This results in the formation of a diol. **Hint:** Visualize the addition of OH groups to the double bond; they will be added to the same side of the ring. ### Step 4: Analyze the Product Structure After the reaction, we get a compound where the two hydroxyl groups are added to adjacent carbon atoms (1 and 2 positions) in a cis configuration. This results in a meso compound because it has a plane of symmetry. **Hint:** A meso compound has multiple stereocenters but is achiral due to its internal symmetry. ### Step 5: Name the Product The product formed is 1,2-cyclohexanediol. Since the hydroxyl groups are added in a cis configuration, we can refer to it as cis-1,2-cyclohexanediol. **Hint:** When naming diols, indicate the positions of the hydroxyl groups and whether they are in a cis or trans configuration. ### Final Answer The product of the reaction of cyclohexene with cold dilute KMnO4 is **cis-1,2-cyclohexanediol**. ### Summary of Steps: 1. Identify the reactant (cyclohexene). 2. Understand the reaction conditions (cold dilute KMnO4). 3. Perform the reaction (syn-dihydroxylation). 4. Analyze the product structure (meso compound). 5. Name the product (cis-1,2-cyclohexanediol).

To solve the question regarding the reaction of cyclohexene with cold dilute KMnO4, we can follow these steps: ### Step 1: Identify the Reactants We start with cyclohexene, which is an alkene with the molecular formula C6H10. It has a double bond between two carbon atoms in a six-membered ring. **Hint:** Remember that cyclohexene is a cyclic compound with a double bond, which makes it reactive towards certain reagents. ### Step 2: Understand the Reaction Conditions ...
Promotional Banner

Topper's Solved these Questions

Similar Questions

Explore conceptually related problems

cis-But -2- ene on reaction with cold dilute KMnO_(4) solution yields

Cyclohexene on reaction with cold alkaline KMnO_4 forms,

Ethene reacts with cold dilute KMnO_(4) to produce

Cyclohexene on oxidation with conc. KMnO_(4) forms

Cyclohexane reacts with cold diliute alkaline KMnO_(4) yield

trans-But -2- ene reacts with cold dilute KMnO_(4) solution to yield

Cyclopentene on treatment with alkaline KMnO_(4) gives

R SHARMA-STEREOCHEMISTRY-Level IV
  1. Which of the following is not corrrect?

    Text Solution

    |

  2. Which of the following is incorrect?

    Text Solution

    |

  3. The compound 1,3-ibromo-2-methy1 butane, CH(3)CHBrCH(CH(3))CH(2)Br, ha...

    Text Solution

    |

  4. Which of the following configuration represents a therosteroisomer?

    Text Solution

    |

  5. Which of the following moleules possesses a peseudoasymmetric carbon a...

    Text Solution

    |

  6. Which of the following molecules has a pro-chiral centre?

    Text Solution

    |

  7. How may 2,3,4,5-terahydroxyadipic acids are possible?

    Text Solution

    |

  8. How many optically active stereoisomers are possible for tri-sec-buty1...

    Text Solution

    |

  9. How many steroisomers are possible for tetra-sec-buty1 methane?

    Text Solution

    |

  10. Which of the following molecules is chiral?

    Text Solution

    |

  11. Cyclohexene on raction with cold dilute KMnO(4) solutioon gives

    Text Solution

    |

  12. Hydrogenation of the compound with H(2) in the presence of Lindle...

    Text Solution

    |

  13. Cyclohexene on reaction with m-chloroperoxbenzpic acid forms a compoun...

    Text Solution

    |

  14. Consider the following sequence of reactions How many structures ...

    Text Solution

    |

  15. In the reaction the major product formed is

    Text Solution

    |

  16. Which one of the following conformations of cyclohexane is chiral?

    Text Solution

    |

  17. P and Q are isomers of dicarboxylic acid C(4)H(4)O(4). Bothdecolorize ...

    Text Solution

    |

  18. Which of the following is correct? (i) The smallest alkene which can...

    Text Solution

    |

  19. The total number of acylic isomers (including steroisomers) of C(4)H(7...

    Text Solution

    |