Home
Class 12
MATHS
If A=tan6^(@) tan 42^(@) and B= cot 66^(...

If `A=tan6^(@) tan 42^(@)` and `B= cot 66^(@)cot 78^(@)` then-

A

`A=2B`

B

`A=1//3B`

C

`A=B`

D

`3A=2B`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we need to evaluate \( A = \tan 6^\circ \tan 42^\circ \) and \( B = \cot 66^\circ \cot 78^\circ \). ### Step 1: Simplifying \( B \) We start with \( B = \cot 66^\circ \cot 78^\circ \). Using the identity \( \cot x = \frac{1}{\tan x} \), we can rewrite \( B \): \[ B = \frac{1}{\tan 66^\circ} \cdot \frac{1}{\tan 78^\circ} = \frac{1}{\tan 66^\circ \tan 78^\circ} \] ### Step 2: Using the Co-Function Identity Next, we can use the co-function identity for tangent: \[ \tan(90^\circ - x) = \cot x \] This means: \[ \tan 66^\circ = \cot 24^\circ \quad \text{and} \quad \tan 78^\circ = \cot 12^\circ \] Thus, we can rewrite \( B \): \[ B = \frac{1}{\tan 66^\circ \tan 78^\circ} = \frac{1}{\cot 24^\circ \cot 12^\circ} \] ### Step 3: Evaluating \( A \) Now, we evaluate \( A = \tan 6^\circ \tan 42^\circ \). Using the identity \( \tan(90^\circ - x) = \cot x \), we can express \( \tan 42^\circ \): \[ \tan 42^\circ = \cot 48^\circ \] Thus, we can rewrite \( A \): \[ A = \tan 6^\circ \cdot \cot 48^\circ \] ### Step 4: Using the Product-to-Sum Identity Using the product-to-sum identities, we know that: \[ \tan x \cot y = \frac{\tan x}{\tan(90^\circ - y)} = \frac{\tan x}{\tan y} \] So we can express: \[ A = \tan 6^\circ \cdot \tan 42^\circ \] ### Step 5: Comparing \( A \) and \( B \) Now we have: \[ A = \tan 6^\circ \tan 42^\circ \] \[ B = \cot 66^\circ \cot 78^\circ = \frac{1}{\tan 66^\circ \tan 78^\circ} \] ### Step 6: Finding the Relationship To find the relationship between \( A \) and \( B \), we can use the fact that \( \tan(90^\circ - x) = \cot x \): \[ \tan 66^\circ = \cot 24^\circ \quad \text{and} \quad \tan 78^\circ = \cot 12^\circ \] Thus, we can conclude that: \[ A = B \] ### Final Answer Therefore, \( A = B \).
Promotional Banner

Topper's Solved these Questions

Similar Questions

Explore conceptually related problems

If A=tan6^(@)tan42^(@) and B=cot66^(@)cot78^(@), then

If A=tan6^(@)tan42^(@) and B=cot66^(@)cot78^(@) then

The value of tan 6^(@) tan 42^(@) tan 66^(@) tan 78^(@) is

If A = tan11^(@)tan29^(@),B=2cot61^(@)cot79^(@) , then:

cot6^(0)cot42^(0)cot66^(@)cot78^(@)=1

Prove that: tan6^(0)tan42^(0)tan66^(@)tan78^(@)=1

The value of tan6^(@)tan42^(@)tan66^(@)tan78^(@) is (a) 1 (b) (1)/(2)(c)(1)/(4)(d)(1)/(8)

ALLEN-COMPOUND ANGLES-EX-01
  1. if sin x + sin^2 x = 1, then the value of cos^2 x + cos^4x is

    Text Solution

    |

  2. 2(sin^6theta+cos^6theta)-3(sin^4theta+cos^4theta) is equal to 0 (b) 1 ...

    Text Solution

    |

  3. cos^2 48^0-sin^2 12^0 is equal to

    Text Solution

    |

  4. The expression (sin 8thetacos theta-sin6 thetacos 3 theta)/(cos 2 thet...

    Text Solution

    |

  5. If 3 sin alpha=5 sin beta, then (tan((alpha+beta)/2))/(tan ((alpha-bet...

    Text Solution

    |

  6. (sin(A-C)+2sinA+sin(A+C))/(sin(B-C)+2sinB+sin(B+C)) is equal to

    Text Solution

    |

  7. (1+sin 2theta+cos 2theta)/(1+sin2 theta-cos 2 theta)=

    Text Solution

    |

  8. If A=tan6^(@) tan 42^(@) and B= cot 66^(@)cot 78^(@) then-

    Text Solution

    |

  9. If x=ycos((2pi)/3)=zcos((4pi)/3), then xy+yz+zx=

    Text Solution

    |

  10. If tanalpha=(1+2^(-x))^(-1), tan beta=(1+2^(x+1))^(-1), then alpha+bet...

    Text Solution

    |

  11. If tanA+tanB+tanC=tanAtanBtanC then

    Text Solution

    |

  12. The value of sin10^@+sin20^@+sin30^@...+sin360^@ is equal to -

    Text Solution

    |

  13. The number of real solutions of the equation sin(e^x)=2^x+2^(-x) is

    Text Solution

    |

  14. If f(x)=sin(3x)/sin x,x!=npi, then the range of values of f(x) for ...

    Text Solution

    |

  15. If cosx+cosy+cosalpha=0 and sinx+siny+sinalpha=0 then cot((x+y)/2)=

    Text Solution

    |

  16. The value of sin(pi/14)sin((3pi)/14)sin((5pi)/14) is

    Text Solution

    |

  17. 18.. Maximum and minimum value of 2sin^2theta-3sintheta+2 is

    Text Solution

    |

  18. For theta in(0,pi/2) , the maximum value of sin(theta+pi/6)+cos(theta+...

    Text Solution

    |

  19. Minimum value of the expression cos^2theta-(6 sintheta cos theta) + 3 ...

    Text Solution

    |