Le Chatelier's principle states that if a change is applied to a system at dynamic equilibrium, the system adjusts to counteract that change and reestablish equilibrium.
Join ALLEN!
(Session 2026 - 27)
Choose class
Choose your goal
Preferred Mode
Choose State
Le Chatelier’s Principle
Henri Le Chatelier's principle states that when a system at equilibrium is subjected to stress (changes in concentration, temperature, or pressure), it adjusts to counteract the stress. Favouring the forward reaction increases product concentrations, while favouring the reverse reaction increases reactant concentrations.
1.0Le Chatelier’s Principle
Le Chatelier's principle states that if a change is applied to a system at dynamic equilibrium, the system adjusts to counteract that change and reestablish equilibrium. This principle is a powerful tool for predicting how temperature, pressure, or concentration changes affect the equilibrium position.
Position of Equilibrium
The position of equilibrium describes the relative amounts of reactants and products in a mixture at equilibrium:
Shifting to the left: Indicates an increase in the concentration of reactants.
Shifting to the right: Indicates an increase in the concentration of products.
2.0Effects of Concentration Change
When the concentration of a substance in the reaction changes, the equilibrium shifts to counteract this change:
Increase in reactant concentration:
The forward reaction rate increases.
More products are formed, shifting the equilibrium to the right.
Decrease in reactant concentration:
The backward reaction rate increases.
More reactants are formed, shifting the equilibrium to the left.
Increase in product concentration:
The backward reaction rate increases.
The equilibrium shifts to the left to reduce the product concentration.
Decrease in product concentration:
The forward reaction rate increases.
The equilibrium shifts to the right to produce more products.
Effects of Concentration on Equilibrium
Change
Equilibrium Shift
Increase in reactant concentration
Shifts to the right
Decrease in reactant concentration
Shifts to the left
Increase in product concentration
Shifts to the left
Decrease in product concentration
Shifts to the right
Effect of Concentration on the Equilibrium Constant (K)
The equilibrium constant, KKK, remains unchanged by changes in the concentration of reactants or products as long as other conditions (e.g., temperature) stay constant.
The ratio [H2][I2][HI]2[HI]2[H2][I2][HI]2[H2][I2] initially decreases.
To restore equilibrium, [H2][H2][H2] and [I2][I2][I2] increase, while [HI][HI][HI] decreases.
Equilibrium is reestablished when the ratio returns to 6.25×10−3.
3.0Effects of Pressure Change
Pressure changes affect only reactions involving gases.
Understanding pressure in gases:
In a fixed volume, the pressure increases as the number of gas molecules increases.
Changes in pressure cause the equilibrium to shift in a way that counteracts the change.
Increase in pressure:
The equilibrium shifts towards the side with fewer gas molecules to reduce pressure.
Decrease in pressure:
The equilibrium shifts towards the side with more gas molecules to increase pressure.
Effects of Pressure on Equilibrium
Change
Equilibrium Shift
Increase in pressure
Shifts to the side, producing fewer gas molecules
Decrease in pressure
Shifts to the side, producing more gas molecules
Effects of Pressure on the Equilibrium Constant
The equilibrium constant K remains unchanged when pressure changes, provided all other factors (e.g., temperature) stay constant.
Note: If the number of gas molecules is the same on both sides of the equation, changes in pressure do not affect the equilibrium position.
4.0Effects of Temperature Change
Temperature changes affect equilibrium by causing the system to shift in a direction that absorbs or releases energy to counteract the change.
Effects of Temperature on Equilibrium Position
Increase in temperature:
The equilibrium shifts in the endothermic direction to absorb energy and counteract the change.
Decrease in temperature:
The equilibrium shifts in the exothermic direction to release energy and counteract the change.
Effects of Temperature on Equilibrium
Change
Equilibrium Shift
Increase in temperature
Shifts in the endothermic direction to absorb energy
Decrease in temperature
Shifts in the exothermic direction to release energy
Effects of Temperature on the Equilibrium Constant (K)
Unlike pressure or concentration changes, temperature directly affects the equilibrium constant K.
For an Endothermic Reaction
Example:
2HI(g)⇌H2(g)+I2(g)
K=[HI]2[H2][I2]K=[HI]2[H2][I2]
Increase in temperature:
The equilibrium shifts right (in the endothermic direction), increasing the concentrations of [H2][H2][H2][H2]and[I2][I2][I2] while [HI][HI][HI] decreases.
Result: K increases.
For an Exothermic Reaction
Example: 2SO2(g)+O2(g)⇌2SO3(g)
K=[SO2]2[O2][SO3]2
Increase in temperature:
The equilibrium shifts left (endothermic direction), decreasing [SO3][SO_3][SO3] while [SO2][SO_2][SO2] and [O2][O_2][O2] increase.
Result: K decreases.
5.0Effect of Inert Gas Addition
The equilibrium position remains unaffected when an inert gas, such as argon, is added to a system at constant volume.
Adding an inert gas does not alter the partial pressures or molar concentrations of the substances involved in the reaction.
The reaction quotient is only affected if the added gas participates as a reactant or product in the reaction.
6.0Effects of a Catalyst
A catalyst is a substance that speeds up the rate of a chemical reaction by equally increasing the rates of both the forward and reverse reactions.
Catalysts do not alter the equilibrium position or the equilibriumconstant's value (K).
They simply help the system reach equilibrium more quickly.
Industrial Processes and Catalysts
In industrial processes, Le Chatelier’s principle predicts conditions that shift the equilibrium toward the desired products, maximising yield. However, reaction kinetics must also be considered, as the reaction rate needs to be practical for efficient production.
Example: For a reversible reaction where the forward reaction is exothermic:
Le Chatelier’s principle states lower temperatures favour the forward reaction, producing a higher equilibrium yield.
However, lower temperatures slow the reaction rate.
Important: A moderate temperature is chosen to balance yield and reaction speed, resulting in a slightly lower yield but faster production.
7.0Heterogeneous Equilibria
Le Chatelier’s principle applies to heterogeneous equilibria as well.
Example: In a fizzy drink bottle, equilibrium exists between dissolved CO2 and gaseous CO2:
CO2(g)⇌CO2(aq)
When the bottle is opened, gaseous CO2 escapes, causing the equilibrium to shift left to replace the lost gas.
This shift produces visible bubbles of CO2.
8.0Solved Examples
Example 1
Q. Use the reaction below:
CO2(g)+H2O(l)⇋H2CO3(aq)
Explain what happens to the position of equilibrium when the system is diluted by adding more water.
Explanation
When more water is added to the system, the concentration of H2O effectively increases. The position of equilibrium shifts to the right, favouring the formation of H2CO3(aq), to reduce the effect of the change according to Le Chatelier's principle.
Example 2
Q. Consider the equilibrium reaction:
COBr2(g)⇌CO(g)+Br2(g)
What happens when inert argon gas, Ar(g), is added?
Explanation
When an inert gas like Ar(g) is introduced to a system at equilibrium, it does not alter the concentrations of the reactants or products, as it does not participate in the reaction. Consequently, the reaction remains at equilibrium.
Example 3
Q. Consider the endothermic reaction:
NH4HS(s)+heat⇌NH3(g)+H2S(g)
What happens when the temperature is increased?
Explanation
For an endothermic reaction, heat can be considered a reactant:
NH4HS(s)+heat⇌NH3(g)+H2S(g)
When the temperature increases, the system shifts to favour the forward reaction to absorb the added heat and reestablish equilibrium