Home
Class 11
CHEMISTRY
The equilibrium constant for the reactio...

The equilibrium constant for the reaction
`A_(2)(g)+B_(2)(g) hArr 2AB(g)`
is `20` at `500K`. The equilibrium constant for the reaction `2AB(g) hArr A_(2)(g)+B_(2)(g)` would be

A

`20`

B

`0.5`

C

`0.05`

D

`10`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we need to determine the equilibrium constant for the reverse reaction given the equilibrium constant for the forward reaction. ### Step-by-Step Solution: 1. **Identify the Forward Reaction and its Equilibrium Constant**: The forward reaction is: \[ A_2(g) + B_2(g) \rightleftharpoons 2AB(g) \] The equilibrium constant \( K_f \) for this reaction is given as \( 20 \) at \( 500 \, K \). 2. **Write the Reverse Reaction**: The reverse reaction is: \[ 2AB(g) \rightleftharpoons A_2(g) + B_2(g) \] We need to find the equilibrium constant \( K_r \) for this reaction. 3. **Relate the Equilibrium Constants**: The equilibrium constant for the reverse reaction is the reciprocal of the equilibrium constant for the forward reaction. This is a fundamental property of equilibrium constants: \[ K_r = \frac{1}{K_f} \] 4. **Calculate the Equilibrium Constant for the Reverse Reaction**: Substituting the value of \( K_f \): \[ K_r = \frac{1}{20} = 0.05 \] 5. **Conclusion**: The equilibrium constant for the reaction \( 2AB(g) \rightleftharpoons A_2(g) + B_2(g) \) is \( 0.05 \). ### Final Answer: The equilibrium constant for the reaction \( 2AB(g) \rightleftharpoons A_2(g) + B_2(g) \) is \( 0.05 \). ---

To solve the problem, we need to determine the equilibrium constant for the reverse reaction given the equilibrium constant for the forward reaction. ### Step-by-Step Solution: 1. **Identify the Forward Reaction and its Equilibrium Constant**: The forward reaction is: \[ A_2(g) + B_2(g) \rightleftharpoons 2AB(g) ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY|Exercise Ex 7.2|40 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY|Exercise Exercises (Subjective)|46 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY|Exercise Archives (Subjective)|11 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    CENGAGE CHEMISTRY|Exercise Archives Subjective|15 Videos
  • CLASSIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    CENGAGE CHEMISTRY|Exercise Analytical and Descriptive Type|3 Videos

Similar Questions

Explore conceptually related problems

The equilibrium constant K_(p) for the reaction H_(2)(g)+I_(2)(g) hArr 2HI(g) changes if:

At a certain temperature, the value of equilibrium constant for the reaction: A_2+2B_2(g) hArr 2AB_2 is 100. What is the equilibrium constant for the reaction. AB_2(g) hArr 1/2A_2 + B_2 ?

The equilibrium constant for the reaction I_2(g) +Cl_2(g) hArr 2ICl(g) at 740 K is 640. What is the equilibrium constant for the reaction ? 2ICl(g) hArr I_2(g)+Cl_2(g) at the same temperature .

The answer to each of the folowing questions is a single digit integar, ranging from 0 to 9. If the correct answers to the question numbers A, B, C and D (say) are 4,0,9 and 2 respectively , then the correct darkening of bubbles should be as shown on the side : Equilibrium constant for the reaction A_(3) (g) + 3 B_(2) (g) hArr 3 AB_(2) (g) " is " 64*0 "Then the equilibrium constant for the reaction " 1/3 A_(3) (g) + B_(2) (g) hArr AB_(2)(g) will be

The value of equilibrium constant for the reaction H_(2)(g)+ I_(2) (g) hArr 2HI (g) is 48 at 720 K What is the value of the equilibrium constant for the reaction 2HI (g) hArr H_(2) (g) + I_(2) (g)

The equilibrium constant for the given reaction is 100. N_(2)(g)+2O_(2)(g) hArr 2NO_(2)(g) What is the equilibrium constant for the reaction ? NO_(2)(g) hArr 1//2 N_(2)(g) +O_(2)(g)

The equilibrium constant of the reaction SO_2(g)+1/2O_2(g) hArr SO_3(g) "is " 4xx10^(-3) "atm"^(-1//2) . The equilibrium constant of the reaction 2SO_3(g)hArr2SO_(2)(g)+O_(2)(g) would be :

the value of equilibrium constant for the reaction HI(g) hArr 1//2 H_(2) (g) +1//2 I_(2) (g) " is " 8.0 The equilibrium constant for the reaction H_(2) (g) +I_(2) (g) hArr 2HI(g) will be

The equilibrium constant of the reaction SO_(2)(g) + 1//2O_(2)(g)hArrSO_(3)(g) is 4xx10^(3)atm^(-1//2) . The equilibrium constant of the reaction 2SO_(3)(g)hArr2SO_(2)(g) + O_(2) would be:

CENGAGE CHEMISTRY-CHEMICAL EQUILIBRIUM-Concept Applicationexercise 7.1
  1. NH(4)COONH(2)(s)hArr2NH(3)(g)+CO(2)(g) If equilibrium pressure is 3 at...

    Text Solution

    |

  2. For the reaction A+B hArr C+D, the initial concentrations of A and B a...

    Text Solution

    |

  3. 15 mol of H(2) and 5.2 moles of I(2) are mixed and allowed to attain e...

    Text Solution

    |

  4. For the reaction: NOCl(g) hArr 2NO(g) +Cl(2)(g), K(c) at 427^(@)C is 3...

    Text Solution

    |

  5. For the reaction CuSO(4).5H(2)O(s) hArr CuSO(4).3H(2)O(s)+2H(2)O(g) ...

    Text Solution

    |

  6. Which one is the correct representation for the reaction 2SO(2)(g)+O...

    Text Solution

    |

  7. For the reaction CO(g)+CI(2)(g)hArrCOCI(2)(g) K(p)//K(c ) is equal...

    Text Solution

    |

  8. The equilibrium constant for the reaction N(2)(g)+O(2)(g) hArr 2NO(g...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. The unit of equilibrium constant K(c) for the reaction A+B hArr C woul...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. To the system, LaCl(3)(s)+H(2)O(g) hArr LaClO(s)+2HCL(g)-"Heat" alre...

    Text Solution

    |

  13. For the reaction, A(g)+2B(g) hArr 2C(g), the rate constant for forward...

    Text Solution

    |

  14. The equilibrium constant for the reaction A(2)(g)+B(2)(g) hArr 2AB(g...

    Text Solution

    |

  15. For the reaction Ag(CN)(2)^(ɵ)hArr Ag^(o+)+2CN^(ɵ), the K(c ) at 25^...

    Text Solution

    |

  16. At a certain temperature, K(c) for SO(2)(g)+NO(2)(g) hArr SO(3)(g)+N...

    Text Solution

    |

  17. HI was heated in a sealed tube at 400^(@)C till the equilibrium was re...

    Text Solution

    |

  18. For the equilibrium AB(g) hArr A(g)+B(g) at a given temperature, the p...

    Text Solution

    |

  19. In a reversible reaction, if the concentration of reactants are double...

    Text Solution

    |

  20. For the equilibrium AB(g) hArr A(g)+B(g). K(p) is equal to four times ...

    Text Solution

    |