Home
Class 11
CHEMISTRY
At a certain temperature, K(c) for SO(...

At a certain temperature, `K_(c)` for
`SO_(2)(g)+NO_(2)(g) hArr SO_(3)(g)+NO(g)`
is `16`. If we take one mole of each of all the equilibrium concentration of NO and `NO_(2)`?

A

`1.6 mol L^(-1)`

B

`0.8 mol L^(-1)`

C

`0.4 mol L^(-1)`

D

`0.6 mol L^(-1)`

Text Solution

Verified by Experts

The correct Answer is:
C

`{:(SO_(2)(g),+,NO_(2)(g),hArr,SO_(3)(g),+,NO(g),),(1,,1,,1,,1,"Initial conc"),(1-x,,1-x,,1+x,,1+x,"At Eq."):}`
`K=([SO_(3)][NO])/([SO_(2)][NO_(2)])=((1+x)(1+x))/((1-x)(1-x))`
`16=((1+x)^(2))/((1-x)^(2))rArr((1+x))/((1-x))=4` or `x=0.6`
`[NO_(2)]=1-x=1-0.6=0.4 "mol" L^(-1)`
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY|Exercise Ex 7.2|40 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY|Exercise Exercises (Subjective)|46 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY|Exercise Archives (Subjective)|11 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    CENGAGE CHEMISTRY|Exercise Archives Subjective|15 Videos
  • CLASSIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    CENGAGE CHEMISTRY|Exercise Analytical and Descriptive Type|3 Videos

Similar Questions

Explore conceptually related problems

At a certain temperature, the equilibrium constant (K_(c )) is 16 for the reaction: SO_(2)(g)+NO_(2)(g)hArrSO_(3)(g)+NO(g) If we take one mole of each of the equilibrium concentration of NO and NO_(2) ?

At a certain temperature, equilibrium constant (K_(c)) is 16 for the reaction: SO_(2)(g)+NO_(2)(g) hArr SO_(3)(g)+NO(g) If we take 1 mol of each of the four gases in a 1-L container, what would be the equilibrium concentrations of NO and NO_(2) ?

At a certain temperature, equilibrium constant (K_(c)) is 16 for the reaction, SO_(2)(g)+NO_(2)(g)hArrSO_(3)(g)+NO_(g) If we take one mole each of all the four gases in a one litre container, what would be the equilibrium concentrations of NO and NO_(2) ?

At a certain temperature, equilibrium constant (Kc) is 16 for the reaction, SO_(2)(g) + NO_(2)(g) rarr SO_(3)(g) + NO(g) If we take one mole each of all the four gases in a one litre container, what would be the equilibrium concentrations of NO "and" NO_(2) ?

The equilibrium K_(c) for the reaction SO_(2)(g)NO_(2)(g)hArrSO_(3)(g)+NO(g)is 16 1 mole of rach of all the four gases is taken in 1dm^(3) vessel , the equilibrium concentration of NO would be:

At a certain temperature the equilibrium constant K_(c) is 0.25 for the reaction A_(2)(g)+B_(2)(g) hArr C_(2)(g)+D_(2)(g) If we take 1 mole of each of the four gases in a 10 litre container, what would be equlibrium concentration of A_(2)(g) ?

At a certain temperature , the equilibrium constant (K_(c)) is 4//9 for the reaction : CO(g)+H_(2)O(g) hArr CO_(2)(g)+H_(2)(g) If we take 10 mole of each of the four gases in a one - litre container, what would be the equilibrium mole percent of H_(2)(g) ?

CENGAGE CHEMISTRY-CHEMICAL EQUILIBRIUM-Concept Applicationexercise 7.1
  1. NH(4)COONH(2)(s)hArr2NH(3)(g)+CO(2)(g) If equilibrium pressure is 3 at...

    Text Solution

    |

  2. For the reaction A+B hArr C+D, the initial concentrations of A and B a...

    Text Solution

    |

  3. 15 mol of H(2) and 5.2 moles of I(2) are mixed and allowed to attain e...

    Text Solution

    |

  4. For the reaction: NOCl(g) hArr 2NO(g) +Cl(2)(g), K(c) at 427^(@)C is 3...

    Text Solution

    |

  5. For the reaction CuSO(4).5H(2)O(s) hArr CuSO(4).3H(2)O(s)+2H(2)O(g) ...

    Text Solution

    |

  6. Which one is the correct representation for the reaction 2SO(2)(g)+O...

    Text Solution

    |

  7. For the reaction CO(g)+CI(2)(g)hArrCOCI(2)(g) K(p)//K(c ) is equal...

    Text Solution

    |

  8. The equilibrium constant for the reaction N(2)(g)+O(2)(g) hArr 2NO(g...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. The unit of equilibrium constant K(c) for the reaction A+B hArr C woul...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. To the system, LaCl(3)(s)+H(2)O(g) hArr LaClO(s)+2HCL(g)-"Heat" alre...

    Text Solution

    |

  13. For the reaction, A(g)+2B(g) hArr 2C(g), the rate constant for forward...

    Text Solution

    |

  14. The equilibrium constant for the reaction A(2)(g)+B(2)(g) hArr 2AB(g...

    Text Solution

    |

  15. For the reaction Ag(CN)(2)^(ɵ)hArr Ag^(o+)+2CN^(ɵ), the K(c ) at 25^...

    Text Solution

    |

  16. At a certain temperature, K(c) for SO(2)(g)+NO(2)(g) hArr SO(3)(g)+N...

    Text Solution

    |

  17. HI was heated in a sealed tube at 400^(@)C till the equilibrium was re...

    Text Solution

    |

  18. For the equilibrium AB(g) hArr A(g)+B(g) at a given temperature, the p...

    Text Solution

    |

  19. In a reversible reaction, if the concentration of reactants are double...

    Text Solution

    |

  20. For the equilibrium AB(g) hArr A(g)+B(g). K(p) is equal to four times ...

    Text Solution

    |