Correct IUPAC name of alkane obtained in the reaciton of 2-chloropropane + sodium and dry ether

Options

A. 2,3-Dimethylbutane
B. 2-Isopropylpropane
C. n-Hexane
D. None of these

Answer

To determine the correct IUPAC name of the alkane obtained from the reaction of 2-chloropropane with sodium in dry ether, we can follow these steps:

### Step 1: Identify the Reactants
The reactant is 2-chloropropane, which has the following structure:
- It consists of three carbon atoms (C3) with a chlorine atom (Cl) attached to the second carbon.

### Step 2: Understand the Reaction
The reaction of 2-chloropropane with sodium in dry ether is known as the Wurtz reaction. This reaction typically involves the coupling of alkyl halides in the presence of sodium, leading to the formation of alkanes.

### Step 3: Determine the Product
When 2-chloropropane reacts with sodium, two molecules of 2-chloropropane can couple together. The chlorine atom is replaced by a bond between the two carbon chains, resulting in a longer carbon chain.

### Step 4: Draw the Structure of the Product
The product formed from the coupling of two 2-chloropropane molecules is:
- CH3-CH(CH3)-CH2-CH(CH3)-CH3
This structure has four carbon atoms in a chain, with two methyl (CH3) groups on the second and third carbon.

### Step 5: Name the Product
To name the product:
1. Identify the longest carbon chain, which contains four carbon atoms (butane).
2. Identify the substituents: there are two methyl groups located on the second and third carbon atoms.
3. Combine this information to derive the IUPAC name: 2,3-dimethylbutane.

### Conclusion
The correct IUPAC name of the alkane obtained from the reaction of 2-chloropropane with sodium in dry ether is **2,3-dimethylbutane**.

---