Home
Class 11
CHEMISTRY
Unit of equilibrium constant for the rev...

Unit of equilibrium constant for the reversible reaction `H_(2) + I_(2)hArr 2HI` is

A

`mol^(-1)` litre

B

`mol^(-2)` litre

C

mol `litre^(-1)`

D

None of these

Text Solution

AI Generated Solution

The correct Answer is:
To determine the unit of the equilibrium constant (Kc) for the reversible reaction: \[ H_2(g) + I_2(g) \rightleftharpoons 2 HI(g) \] we can follow these steps: ### Step 1: Write the expression for the equilibrium constant (Kc) The equilibrium constant expression for the reaction is given by: \[ K_c = \frac{[HI]^2}{[H_2][I_2]} \] where \([HI]\), \([H_2]\), and \([I_2]\) represent the molar concentrations (in moles per liter, M) of the respective species at equilibrium. ### Step 2: Substitute the units into the Kc expression Now, we will substitute the units into the expression. The concentration units are moles per liter (M), so we can write: \[ K_c = \frac{(M)^2}{(M)(M)} = \frac{M^2}{M^2} \] ### Step 3: Simplify the expression When we simplify the expression, we find: \[ K_c = \frac{M^2}{M^2} = 1 \] ### Step 4: Conclusion about the units Since the units cancel out, we conclude that the equilibrium constant \(K_c\) is unitless. ### Final Answer The unit of the equilibrium constant for the reaction \(H_2 + I_2 \rightleftharpoons 2 HI\) is **unitless**. ---

To determine the unit of the equilibrium constant (Kc) for the reversible reaction: \[ H_2(g) + I_2(g) \rightleftharpoons 2 HI(g) \] we can follow these steps: ### Step 1: Write the expression for the equilibrium constant (Kc) The equilibrium constant expression for the reaction is given by: ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Application Of Equllibrium Constant (K)|65 Videos
  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Le - Chatellers'S Principle|93 Videos
  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Section D - Chapter End Test|30 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    A2Z|Exercise Section D - Chapter End Test|30 Videos
  • CHEMICAL THERMODYNAMICS

    A2Z|Exercise Section D - Chapter End Test|30 Videos

Similar Questions

Explore conceptually related problems

The equilibrium constant for the reversible reaction N_(2)+3H_(2) hArr 2NH_(3) is K and for the reaction (1)/(2) N_(2)+(3)/(2) H_(2) hArr NH_(3) , the equilibrium constant is K',.K and K' will be related as

The value of equilibrium constant for the reaction H_(2)(g)+ I_(2) (g) hArr 2HI (g) is 48 at 720 K What is the value of the equilibrium constant for the reaction 2HI (g) hArr H_(2) (g) + I_(2) (g)

Equilibrium concentration of HI, I_(2) and H_(2) is 0.7, 0.1 and 0.1 M respectively. The equilibrium constant for the reaction, I_(2)+H_(2)hArr 2HI is :

On a given condition, the equilibrium concentration of H, H_(2) and I_(2) are 0.80 , 0.10 and 0.10 mole/litre. The equilibrium constant for the reaction H_(2) + I_(2) hArr 2HI will be

Suppose the value of the equilibrium constant for the given reaction H_2(g) + I_(2)(g) hArr 2HI(g) at 717 K is 64, then calculate the same (eq. const.) for the reaction HI hArr 1/2 H_2 + 1/2 I_2 .

If the equilibrium constant of the reversible reaction HI(g)hArr1//2H_2(g)+1//2I_2(g) is 7.4 , the equilibrium constant for the reversible reaction 2HI(g)hArrH_2(g)+I_2(g) will be

The value of the equilibrium constant for the reaction : H_(2) (g) +I_(2) (g) hArr 2HI (g) at 720 K is 48. What is the value of the equilibrium constant for the reaction : 1//2 H_(2)(g) + 1//2I_(2)(g) hArr HI (g)

the value of equilibrium constant for the reaction HI(g) hArr 1//2 H_(2) (g) +1//2 I_(2) (g) " is " 8.0 The equilibrium constant for the reaction H_(2) (g) +I_(2) (g) hArr 2HI(g) will be

A2Z-CHEMICAL EQUILIBRIUM-Calculation Of Equilibrium Constant
  1. The active mass of 64 g of HI in a 2-L flask would be

    Text Solution

    |

  2. In the reaction C(s) + CO(2)(g)hArr2CO(g) the following amounts of sbs...

    Text Solution

    |

  3. At a certain temp. 2HI hArrH(2) + I(2) . Only 50% HI is dissociated at...

    Text Solution

    |

  4. In a chemical equilibrium, the rate constant for the backward reaction...

    Text Solution

    |

  5. The value of K(p) fot the reaction 2H(2)O(g) + 2CI(2)(g)hArr4HCI(g) + ...

    Text Solution

    |

  6. For the reaction PCI(3)(g) + CI(2)(g)hArrPCI(5)(g), the value of K(p) ...

    Text Solution

    |

  7. Unit of equilibrium constant for the reversible reaction H(2) + I(2)hA...

    Text Solution

    |

  8. For the decomposition reaction NH(2)COONH(4)(s)hArr2NH(3)(g) + CO(2)(g...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. A mixture of 0.3 mole of H(2) and 0.3 mole of I(2) is allowed to react...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. The decomposition of N(2)O(4) to NO(2) is carried out at 280^(@)C in c...

    Text Solution

    |

  13. For the reaction equilibrium, N(2)O(4(g))hArr2NO(2(g)), the concentrat...

    Text Solution

    |

  14. Given N(2)(g)+3H(2)(g)hArr2NH(3)(g),K(1) N(2)(g)+O(2)(g)hArr2NO(g)...

    Text Solution

    |

  15. What is the equilibrium expression for the reaction P(4(s)) + 5O(2(g)...

    Text Solution

    |

  16. In the gas phase reaction, C(2H(5) + H(2)hArrC(2)H(6), the equilibriou...

    Text Solution

    |

  17. For the reaction, 2NO(2(g))hArr2NO((g)) + O(2(g)) K(c) = 1.0xx10^(-6) ...

    Text Solution

    |

  18. The rate of forward reaction is two times that of reverse reaction at ...

    Text Solution

    |

  19. In a reaction A + B hArrC + D, the concentration of A, B, C and D (in...

    Text Solution

    |

  20. For the following three reaction 1, 2 and 3, equilibrium constants are...

    Text Solution

    |