Home
Class 11
CHEMISTRY
In a reaction A + B hArrC + D, the conc...

In a reaction `A + B hArrC + D`, the concentration of A, B, C and D (in moles/litre) are `0.5, 0.8, 0.4` and `1.0` respectively. The equilibrium constant is

A

`0.1`

B

`1.0`

C

`10`

D

`oo`

Text Solution

Verified by Experts

The correct Answer is:
B
For A + B `hArr C + D `
`K = ([C][D])/([A][B]) = (0.4xx1)/(0.5xx0.8) = 1`
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Application Of Equllibrium Constant (K)|65 Videos

  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Le - Chatellers'S Principle|93 Videos

  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Section D - Chapter End Test|30 Videos

  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    A2Z|Exercise Section D - Chapter End Test|30 Videos

  • CHEMICAL THERMODYNAMICS

    A2Z|Exercise Section D - Chapter End Test|30 Videos

Similar Questions

Explore conceptually related problems

In a reaction A+Bharr C+D the concentrations of A,B,C and D in (moles/litre) are 0.5, 0.8, 0.4 and 1.0 respectively. The equillibrium constant is

In the reversible reaction A + B hArr C + D, the concentration of each C and D at equilobrium was 0.8 mole/litre, then the equilibrium constant K_(c) will be

In an experiment the equilibrium constant for the reaction A+BhArr C+D is K_(C) when the initial concentration of A and B each is 0.1 mole. Under similar conditions in an another experiment if the initial concentration of A and B are taken to be 2 and 3 moles respectively then the value of equilibrium constant will be

The half-life for a reaction at initial concentration of 0.5 and 1.0 "mole litre"^(-1) are 200 sec and 100 sec respectively. The order of the reaction is

On a given condition, the equilibrium concentration of H, H_(2) and I_(2) are 0.80 , 0.10 and 0.10 mole/litre. The equilibrium constant for the reaction H_(2) + I_(2) hArr 2HI will be

The initial molar concentration of the reactants A and B were 0.1 M and 0.2 M respectively in the following reaction A+B hArr 2C When equilibrium was attained the concentration of A in the reaction mixture was found to be 0.06M . Calculate the equilibrium constant.

In the reaction, A + B hArr2C , at equilibrium, the concentration of A and B is 0.20 mol L^(-1) each and that of C was found to be 0.60 mol L^(-1) . The equilibrium constant of the reaction is

A2Z-CHEMICAL EQUILIBRIUM-Calculation Of Equilibrium Constant
  1. The active mass of 64 g of HI in a 2-L flask would be

    Text Solution

    |

  2. In the reaction C(s) + CO(2)(g)hArr2CO(g) the following amounts of sbs...

    Text Solution

    |

  3. At a certain temp. 2HI hArrH(2) + I(2) . Only 50% HI is dissociated at...

    Text Solution

    |

  4. In a chemical equilibrium, the rate constant for the backward reaction...

    Text Solution

    |

  5. The value of K(p) fot the reaction 2H(2)O(g) + 2CI(2)(g)hArr4HCI(g) + ...

    Text Solution

    |

  6. For the reaction PCI(3)(g) + CI(2)(g)hArrPCI(5)(g), the value of K(p) ...

    Text Solution

    |

  7. Unit of equilibrium constant for the reversible reaction H(2) + I(2)hA...

    Text Solution

    |

  8. For the decomposition reaction NH(2)COONH(4)(s)hArr2NH(3)(g) + CO(2)(g...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. A mixture of 0.3 mole of H(2) and 0.3 mole of I(2) is allowed to react...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. The decomposition of N(2)O(4) to NO(2) is carried out at 280^(@)C in c...

    Text Solution

    |

  13. For the reaction equilibrium, N(2)O(4(g))hArr2NO(2(g)), the concentrat...

    Text Solution

    |

  14. Given N(2)(g)+3H(2)(g)hArr2NH(3)(g),K(1) N(2)(g)+O(2)(g)hArr2NO(g)...

    Text Solution

    |

  15. What is the equilibrium expression for the reaction P(4(s)) + 5O(2(g)...

    Text Solution

    |

  16. In the gas phase reaction, C(2H(5) + H(2)hArrC(2)H(6), the equilibriou...

    Text Solution

    |

  17. For the reaction, 2NO(2(g))hArr2NO((g)) + O(2(g)) K(c) = 1.0xx10^(-6) ...

    Text Solution

    |

  18. The rate of forward reaction is two times that of reverse reaction at ...

    Text Solution

    |

  19. In a reaction A + B hArrC + D, the concentration of A, B, C and D (in...

    Text Solution

    |

  20. For the following three reaction 1, 2 and 3, equilibrium constants are...

    Text Solution

    |