Home
Class 11
CHEMISTRY
In the reversible reaction A + B hArr C ...

In the reversible reaction A + B `hArr` C + D, the concentration of each C and D at equilobrium was `0.8` mole/litre, then the equilibrium constant `K_(c)` will be

A

`6.4`

B

`0.64`

C

`1.6`

D

`16.0`

Text Solution

Verified by Experts

The correct Answer is:
D
Sach of 1 mole of A and B is taken, then each of `0.8` mole/litre of C and D formed remaining concentration of A and B will be `(1 - 0.8)= 0.2` mole/litre
`K_(c) = ([C][D])/([A][B]) = (0.8xx0.8)/(0.2xx0.2) = 16.0`
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    A2Z|Exercise Assertion - Reasoning Questions|5 Videos

  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    A2Z|Exercise Section D - Chapter End Test|30 Videos

  • CHEMICAL THERMODYNAMICS

    A2Z|Exercise Section D - Chapter End Test|30 Videos

Similar Questions

Explore conceptually related problems

In a reaction A + B hArrC + D , the concentration of A, B, C and D (in moles/litre) are 0.5, 0.8, 0.4 and 1.0 respectively. The equilibrium constant is

In a reaction A+Bharr C+D the concentrations of A,B,C and D in (moles/litre) are 0.5, 0.8, 0.4 and 1.0 respectively. The equillibrium constant is

For the reaction A+B hArr C+D , the initial concentrations of A and B are equal. The equilibrium concentration of C is two times the equilibrium concentration of A. The value of equilibrium constant is ………..

In a gaseous reaction A+2B iff 2C+D the initial concentration of B was 1.5 times that of A. At equilibrium the concentration of A and D were equal. Calculate the equilibrium constant K_(C) .

In an experiment the equilibrium constant for the reaction A+BhArr C+D is K_(C) when the initial concentration of A and B each is 0.1 mole. Under similar conditions in an another experiment if the initial concentration of A and B are taken to be 2 and 3 moles respectively then the value of equilibrium constant will be

A+B rarr C+D Initially moles of A and B are equal. At equilibrium, moles of C are three times of A. The equilibrium constant of the reaction will be

A2Z-CHEMICAL EQUILIBRIUM-Section D - Chapter End Test
  1. If pressure is applied to the following equilibrium, liquid hArr vapou...

    Text Solution

    |

  2. For the reaction, A+BhArr3C, at 25^(@)C, a 3 litre vessel contains 1, ...

    Text Solution

    |

  3. The equilibrium constant for a reacton N(2)(g)+O(2)(g)=2NO(g) is 4xx...

    Text Solution

    |

  4. In the system A((s))hArr2B((g))+3C((g)), if the concentration of C at ...

    Text Solution

    |

  5. In a reaction at equilibrium, 'x' mole of reactant A decompose to give...

    Text Solution

    |

  6. If CuSO(4).5H(2)O((s))hArrCuSO(4).3H(2)O((s)) + 2H(2)O((l)) K(p) = 1.0...

    Text Solution

    |

  7. In the system, LaCI(3(s)) + H(2)O(g) + heat rarr LaCIO(s) + 2HCI(g) , ...

    Text Solution

    |

  8. The equilibrium constant for the reaction N(2)(g)+O(2)(g) hArr 2NO(g) ...

    Text Solution

    |

  9. For the decomposition reaction: NH(2)COONH(4(s))hArr2NH(3(g))+CO(2(g...

    Text Solution

    |

  10. For a reaction A((g)) + B((g))hArrC((g)) + D((g)) the intial concentra...

    Text Solution

    |

  11. The partial pressure of CH(3)OH((g)), CO((g)) and H(2(g)) in equilibri...

    Text Solution

    |

  12. For reaction A(g) + B(g) we start with 2 moles of A and B each. At equ...

    Text Solution

    |

  13. In the reversible reaction A + B hArr C + D, the concentration of each...

    Text Solution

    |

  14. 2 moles of PCl(5) was heated in a closed vessel of 2 litre capacity. A...

    Text Solution

    |

  15. A mixture of 0.3 mole of H(2) and 0.3 mole of I(2) is allowed to react...

    Text Solution

    |

  16. CH(3)COOH((l)) + C(2)H(5)OH((l))hArrCH(3)COOC(2)H(5(l)) + H(2)O((l)) I...

    Text Solution

    |

  17. If the equilibrium constant of the reaction 2HI hArrH(2) + I(2) is 0.2...

    Text Solution

    |

  18. Assertion : K(p) = K(c) for all reaction. Reason : At constant tempe...

    Text Solution

    |

  19. Assertion : The equilibrium constant for the reaction CaSO(4).5H(2)O(s...

    Text Solution

    |

  20. Assertion : On cooling a freezing mixture, color of the mixture turns ...

    Text Solution

    |