Home
Class 11
CHEMISTRY
A student named a certain compound as 2,...

A student named a certain compound as `2,3-` diethylbutane. Its correct `IUPAC` names is

A

`2,3-`Dimethylhexane

B

`3,4-`Dimethylhexane

C

`2-`Ethyl`-3-`methylpentane

D

`2-`Ethylbutane

Text Solution

AI Generated Solution

The correct Answer is:
To determine the correct IUPAC name for the compound initially named as `2,3-diethylbutane`, we will follow these steps: ### Step 1: Identify the Longest Carbon Chain The name `butane` suggests that the longest continuous carbon chain should contain four carbon atoms. However, the presence of `diethyl` indicates that there are two ethyl groups attached to the main chain. ### Step 2: Draw the Structure Based on the name `2,3-diethylbutane`, we can draw a structure with a four-carbon chain (butane) and two ethyl groups on the second and third carbon atoms. ``` C2H5 | C2H5-C-C-C ``` ### Step 3: Count the Carbons Upon drawing the structure, we see that there are actually more than four carbon atoms present due to the two ethyl groups. Each ethyl group contributes two carbon atoms, which means the total number of carbon atoms is: - 4 (from butane) + 2 (from one ethyl) + 2 (from the other ethyl) = 8 carbons. ### Step 4: Determine the Correct Parent Chain Since there are 8 carbon atoms, the parent chain should be named as `octane`, not `butane`. ### Step 5: Identify the Substituents Now, we need to identify the positions of the ethyl groups on the octane chain. The structure can be represented as follows: ``` C2H5 | C2H5-C-C-C-C-C ``` The ethyl groups are located on the 2nd and 3rd carbon atoms of the octane chain. ### Step 6: Write the Correct IUPAC Name The correct IUPAC name for the compound, considering the longest chain and the positions of the substituents, is `3,4-diethyloctane`. ### Final Answer The correct IUPAC name is **3,4-diethyloctane**. ---

To determine the correct IUPAC name for the compound initially named as `2,3-diethylbutane`, we will follow these steps: ### Step 1: Identify the Longest Carbon Chain The name `butane` suggests that the longest continuous carbon chain should contain four carbon atoms. However, the presence of `diethyl` indicates that there are two ethyl groups attached to the main chain. ### Step 2: Draw the Structure Based on the name `2,3-diethylbutane`, we can draw a structure with a four-carbon chain (butane) and two ethyl groups on the second and third carbon atoms. ...
Promotional Banner

Topper's Solved these Questions

  • CLASSIFICTION, PURIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    A2Z|Exercise Nomenclature Of Alkenes And Alkynes|22 Videos
  • CLASSIFICTION, PURIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    A2Z|Exercise Nomenclature Of Compounds Containing One Functional Group|36 Videos
  • CLASSIFICATION OF ELEMENTS AND PERIODICITY OF PROPERTIES

    A2Z|Exercise Section D - Chapter End Test|30 Videos
  • ENVIRONMENTAL CHEMISTRY

    A2Z|Exercise Section D - Chapter End Test|30 Videos

Similar Questions

Explore conceptually related problems

A student names a certain compound as 2, 3 -diethylbutane. Its correct IUPAC names is:

A student named a certain compound as 2,3-diethylbutane. Its correct IUPAC name is a) 2,3-dimethylhexane b) 3,4-dimethylhexane c) 2-ethyl-3-methylpentane d) 2-ethylbutane

The correct IUPAC name of compound

IUPAC name of a compound is 2-Ethoxy butane . Its common name is

The correct IUPAC name of compounds

What is the correct IUPAC name of this compound?

The correct IUPAC name of compound is:

Which is the correct IUPAC name of this compound

The correct IUPAC name of the compound is

A2Z-CLASSIFICTION, PURIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS-Section D - Chapter End Test
  1. A student named a certain compound as 2,3- diethylbutane. Its correct ...

    Text Solution

    |

  2. There is something wrong in the name of the compound named : 2-bromo...

    Text Solution

    |

  3. An organic compound contains 49.3% carbon 6.84% hydrogen and its vapou...

    Text Solution

    |

  4. Ethyoxyethene is written as follows, H(2)C=CH-O-CH(2)-CH(3). The s...

    Text Solution

    |

  5. If 0.228 g of silver salt of dibasic acid gabe a residue of 0.162 g of...

    Text Solution

    |

  6. Which of the following compound is unsaturated hydrocarbon.

    Text Solution

    |

  7. 0.0833 mol of carbohydrate of empirical formula CH(2)O contain 1 g of...

    Text Solution

    |

  8. The correct IUPAC name of the compound is :

    Text Solution

    |

  9. 116 mg of a compound on vaporisation in a Victor - Meyer's apparatus d...

    Text Solution

    |

  10. According to IUPAC convention, the correct name of the following compo...

    Text Solution

    |

  11. A gas mixture contains 50% helium and 50% methane by volume. What is t...

    Text Solution

    |

  12. What is the correct IUPAC name of the following compound ?

    Text Solution

    |

  13. 0.5g of hydrocarbone gave 0.9 g water on combustion . The percentage ...

    Text Solution

    |

  14. What is the correct IUPAC name of the compound shown below?

    Text Solution

    |

  15. Lassaigne's test for the detection of nitrogen will fail in case of :

    Text Solution

    |

  16. The correct IUPAC name of the compound shown below

    Text Solution

    |

  17. Camphor is often used in molecular mass determination because

    Text Solution

    |

  18. In Kjeldahl's method, nitrogen present is estimated as :

    Text Solution

    |

  19. How many H- atoms are present in 0.046 g of ethanol ?

    Text Solution

    |

  20. In the compound CH(2)=CH-CH(2)-CH(2)-C-=CH the C(2)-C(3) bond is of

    Text Solution

    |

  21. A hydrocarbon contains 10.5 gm carbon and 1 gm hydrogen. Its 2.4 gm ha...

    Text Solution

    |