Home
Class 12
CHEMISTRY
In the reaction the major product f...

In the reaction

the major product formed is

A

B

C

D

Text Solution

Verified by Experts

The correct Answer is:
C
We can reject options `(2)` and `(4)` because addition of `HOCI` to alkenes is an anti addition. Of the two options `(1)` and `(3)`, we accept `(3)` because it is formed through more stable benzy`1` carbocation:
Promotional Banner

Topper's Solved these Questions

Similar Questions

Explore conceptually related problems

In the reaction the major product (s) formed is (are) ,

In the following reaction the major product formed is :

Consider the above reaction, the major product "P" formed is :-

Consider the following reaction select the major product formed in the given reaction

Consider the following reaction: The major products formed in this reaction are:

Consider the following reaction, The major product formed in the above reaction is

In the reaction given below, the major product formed is:

R SHARMA-STEREOCHEMISTRY-Level IV
  1. Which of the following is not corrrect?

    Text Solution

    |

  2. Which of the following is incorrect?

    Text Solution

    |

  3. The compound 1,3-ibromo-2-methy1 butane, CH(3)CHBrCH(CH(3))CH(2)Br, ha...

    Text Solution

    |

  4. Which of the following configuration represents a therosteroisomer?

    Text Solution

    |

  5. Which of the following moleules possesses a peseudoasymmetric carbon a...

    Text Solution

    |

  6. Which of the following molecules has a pro-chiral centre?

    Text Solution

    |

  7. How may 2,3,4,5-terahydroxyadipic acids are possible?

    Text Solution

    |

  8. How many optically active stereoisomers are possible for tri-sec-buty1...

    Text Solution

    |

  9. How many steroisomers are possible for tetra-sec-buty1 methane?

    Text Solution

    |

  10. Which of the following molecules is chiral?

    Text Solution

    |

  11. Cyclohexene on raction with cold dilute KMnO(4) solutioon gives

    Text Solution

    |

  12. Hydrogenation of the compound with H(2) in the presence of Lindle...

    Text Solution

    |

  13. Cyclohexene on reaction with m-chloroperoxbenzpic acid forms a compoun...

    Text Solution

    |

  14. Consider the following sequence of reactions How many structures ...

    Text Solution

    |

  15. In the reaction the major product formed is

    Text Solution

    |

  16. Which one of the following conformations of cyclohexane is chiral?

    Text Solution

    |

  17. P and Q are isomers of dicarboxylic acid C(4)H(4)O(4). Bothdecolorize ...

    Text Solution

    |

  18. Which of the following is correct? (i) The smallest alkene which can...

    Text Solution

    |

  19. The total number of acylic isomers (including steroisomers) of C(4)H(7...

    Text Solution

    |