Correct name for the following compound is `:`
`Cl-CH_(2)-overset(O)overset(||)(C)-O-overset(O)overset(||)(C)-CH_(2)-Cl`

Options

A. Bis ( Chloroacetic anhydride)
B. Bis(Chloroethanoic anhydride)
C. Chloroethanoic anhydride
D. `1-`Chloroethanoyloxy`-2-`chloroethenone

Explanation

To determine the correct name for the compound `Cl-CH2-C(=O)-O-C(=O)-CH2-Cl`, we will follow these steps:

### Step 1: Identify the Structure
The compound consists of two carbonyl groups (C=O) and two chlorine atoms (Cl) attached to CH2 groups. The structure can be visualized as:
- Two CH2 groups at the ends.
- Two carbonyl groups connected by an oxygen atom (indicating an anhydride).

### Step 2: Recognize the Functional Groups
The presence of the carbonyl groups and the oxygen connecting them indicates that this compound is an anhydride. Specifically, it is an anhydride of acetic acid (ethanoic acid), since acetic acid has the structure CH3COOH.

### Step 3: Determine the Parent Acid
The parent acid here is acetic acid (ethanoic acid), which has the formula CH3COOH. When forming the anhydride, the -OH group from two acetic acid molecules is removed, resulting in the anhydride structure.

### Step 4: Naming the Compound
Since there are two chlorine atoms attached to the CH2 groups, we need to indicate this in the name. The correct IUPAC name would include the prefix "bis" to denote the two chlorine substituents.

- The full name can be constructed as follows:
- "Bis" indicates two chlorine atoms.
- "Chloro" indicates the presence of chlorine.
- "Ethanoic anhydride" indicates that it is the anhydride of acetic acid.

Thus, the IUPAC name for the compound is **Bis(chloro)ethanoic anhydride** or **Bis(chloro)acetic anhydride**.

### Step 5: Common Name
In common nomenclature, the compound can be referred to as **Chloroethanoic anhydride**. However, it is important to note that in common names, we do not use the "bis" prefix.

### Final Answer
The correct name for the compound is **Bis(chloro)ethanoic anhydride** or **Bis(chloro)acetic anhydride**.

---