Orlon is polymer of: 1) CH, =CH-CH 2) CH, = CH - CN 3) CF, =CF, 4) CH2-CH=CH

Which is not the correct representation of the pi electron transfer? 1) CH_3-CH=CH_2 2) CH_2=CH-CH_2-CH_3 3) CH_3-CH=CHCN 4) CH_3-CO-CH_2-CH=CH_2

The least and most stable resonating structure respectively are: (1) CH_(2)=CH-CH-CH-C-CH_(3) (2) CH_(2)=CH-CH-CH=C-CH_(3)O^(Theta) (3) CH_(2)-CH-CH=CH-C-CH_(3) (4) CH_(2)=CH-CH=CH-C-CH_(3) (А) 1,4 (В) 2,3 (С) 4,1

Which is the most suitable reagent among the following distinguish compound (3) from the others ? (1) CH_3C-= C-CH_3 (2) CH_3CH_2 -CH_2 -CH_3 (3) CH_3 CH_2 C-=CH (4) CH_3 CH =CH_2

Write iupac name of CH3-CH(CH3)-CH2-CH(CH2CH3)2

The following two isomeric alkenes are related as - (I) CH_(3)-CH=CH-CH_(2)-CH_(2)-CH_(3) (II) CH_(3)-CH_(2)-CH=CH-CH_(2)-CH_(3)

The following two isomeric alkenes are related as - (I) CH_(3)-CH=CH-CH_(2)-CH_(2)-CH_(3) (II) CH_(3)-CH_(2)-CH=CH-CH_(2)-CH_(3)

The IUPAC name of {:(CH_2=CH-CH-CH_2-CH_3),(" "|),(" "CH_2-CH_2-CH_3):}

Arrange the following compounds in increasing order of S_(N^1) reactivity. ClCH_2 = CH CH_2CH_3, CH_3C (Cl) = CH CH_2 CH_3, CH_2 = CH CH_2 CH_2 Cl, CH_3CH = CH. CHCl CH_3 .

CH_(3)CH_(2)CH = CH_(2)" and "CH_(3)CH = CH - CH_(3) show