Statement-1: 4-ethyl-3-bromo pentanoic acid is not the correct IUPAC name.
Statement-2: Selection of carbon chain in 3-bromo-4-ethyl pentanoic acid is not according to IUPAC rule.

Options

A. Both the statements are correct but Statement 2 is not the correct explanation of Statement 1
B. Both the statements are correct but Statement 2 is the correct explanation of Statement 1
C. Statement 1 is correct but Statement 2 is incorrect
D. Both the statements are incorrect

Answer

To analyze the statements regarding the IUPAC naming of the compound 4-ethyl-3-bromopentanoic acid, we will follow these steps:

### Step 1: Understand the structure of the compound
- The name "4-ethyl-3-bromopentanoic acid" suggests a pentanoic acid (which has a 5-carbon chain) with an ethyl group on the 4th carbon and a bromo group on the 3rd carbon.

### Step 2: Draw the structure
- Drawing the structure based on the name:
- Pentanoic acid has the structure:
```
CH3-CH2-CH2-CH2-COOH
```
- Adding the ethyl group (C2H5) on the 4th carbon and the bromo group (Br) on the 3rd carbon:
```
CH3-CH2-CH(Br)-CH(C2H5)-COOH
```

### Step 3: Count the carbon chain
- In the drawn structure, we have:
- 1 (from COOH) + 4 (from the chain) + 2 (from the ethyl group) = 6 carbons in total.
- Therefore, the longest carbon chain is actually 6 carbons long, which means the correct base name should be hexanoic acid, not pentanoic acid.

### Step 4: Determine the correct IUPAC name
- Since the longest chain is 6 carbons, the correct name should be 4-ethyl-3-bromohexanoic acid, not 4-ethyl-3-bromopentanoic acid.

### Step 5: Analyze the statements
- **Statement 1**: "4-ethyl-3-bromopentanoic acid is not the correct IUPAC name."
- This statement is **true** because the correct name should be 4-ethyl-3-bromohexanoic acid.

- **Statement 2**: "Selection of carbon chain in 3-bromo-4-ethyl pentanoic acid is not according to IUPAC rule."
- This statement is also **true** because the longest carbon chain should have been selected as hexanoic acid instead of pentanoic acid.

### Conclusion:
- Both statements are correct. However, Statement 2 is the correct explanation for Statement 1.

### Final Answer:
- Both statements are correct, and Statement 2 is the correct explanation of Statement 1.

---