IUPAC name of following organic compound `CH_3-overset(O)overset(||)C-underset(OH)underset(|)(CH)-underset(NH_2)underset(|)(CH)-COOH`

Options

A. 2 - amino - 3 - hydroxy - 4 - oxopentanoic acid
B. 4 - amino -3 - hydroxy - 2- oxopentanoic acid
C. 2 - amino - 3- hydroxy - 4- ketopentanoic acid
D. 4 - amino -3 - hydroxy - 2- ketopentanoic acid

Answer

To derive the IUPAC name of the given organic compound `CH3-C(=O)-CH(OH)-CH(NH2)-COOH`, we will follow the systematic approach outlined in the video transcript. Here’s a step-by-step breakdown of the process:

### Step 1: Identify the Longest Carbon Chain
First, we need to identify the longest continuous carbon chain in the compound. The structure can be visualized as follows:

```
CH3
|
C(=O)
|
CH(OH)
|
CH(NH2)
|
COOH
```

The longest carbon chain consists of 5 carbon atoms, which is referred to as the parent chain.

### Step 2: Number the Carbon Chain
Next, we will number the carbon chain starting from the end closest to the highest priority functional group (the carboxylic acid, -COOH). The numbering will be as follows:

1. COOH (1)
2. CH(NH2) (2)
3. CH(OH) (3)
4. C(=O) (4)
5. CH3 (5)

### Step 3: Identify and Name the Substituents
Now we identify the substituents on the carbon chain:
- At carbon 2, we have an amino group (-NH2), which is named as "amino".
- At carbon 3, we have a hydroxyl group (-OH), which is named as "hydroxy".
- At carbon 4, we have a carbonyl group (C=O), which is a ketone and is named as "oxo".

### Step 4: Combine the Names
Now we combine the names of the substituents with their respective positions:
- 2-Amino
- 3-Hydroxy
- 4-Oxo

### Step 5: Name the Parent Chain
The parent chain has 5 carbons and contains a carboxylic acid group, so it is named as "pentanoic acid". Since it is a carboxylic acid, we drop the "e" from "pentane" and add "oic acid".

### Step 6: Finalize the IUPAC Name
Combining all the parts together, we get:
- 2-Amino-3-Hydroxy-4-Oxopentanoic Acid

Thus, the final IUPAC name of the compound is **2-Amino-3-Hydroxy-4-Oxopentanoic Acid**.