The number of stereoisomers of the given compound
`CH_(3)-overset(Cl)overset(|)CH-overset(Cl)overset(|)CH-overset(Cl)overset(|)CH-CH_(3)`
will be

Answer

To determine the number of stereoisomers for the compound `CH3-CH(Cl)-CH(Cl)-CH(Cl)-CH3`, we need to follow these steps:

### Step 1: Identify Chiral Centers
First, we need to identify the chiral centers in the compound. A chiral center is typically a carbon atom that is bonded to four different substituents.

In the given compound:
- The carbon atoms that are bonded to chlorine (Cl) are potential chiral centers.
- We have three carbon atoms (let's denote them as C1, C2, and C3) that are each bonded to a Cl atom.

### Step 2: Analyze Each Chiral Center
Next, we analyze the configuration of each chiral center:
- If C1 has a configuration (R or S), we need to see how it affects the configurations of C2 and C3.
- The chirality of C2 and C3 can depend on the configurations of the adjacent carbons (C1 and C2).

### Step 3: Determine Possible Configurations
For each chiral center, there are two possible configurations (R or S):
- For C1, we can have R or S.
- For C2, we can also have R or S, but its chirality will depend on the configuration of C1.
- For C3, similarly, it can also be R or S, depending on the configurations of C1 and C2.

### Step 4: Count Stereoisomers
To count the total number of stereoisomers:
- If all three carbons (C1, C2, C3) are chiral and can have independent configurations, the total number of stereoisomers can be calculated using the formula \(2^n\), where \(n\) is the number of chiral centers.
- In this case, we have 3 chiral centers, so the total number of stereoisomers would be \(2^3 = 8\).

However, we must consider the possibility of symmetry or identical configurations leading to fewer unique stereoisomers.

### Step 5: Final Count
After analyzing the configurations and considering the potential for symmetry, we conclude that the total number of unique stereoisomers for the compound is 4.

### Final Answer
The number of stereoisomers of the given compound is **4**.

---