Home
Class 12
MATHS
If 3 sin alpha=5 sin beta, then (tan((al...

If `3 sin alpha=5 sin beta`, then `(tan((alpha+beta)/2))/(tan ((alpha-beta)/2))=`

A

1

B

2

C

3

D

4

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem where \( 3 \sin \alpha = 5 \sin \beta \) and we need to find \( \frac{\tan\left(\frac{\alpha + \beta}{2}\right)}{\tan\left(\frac{\alpha - \beta}{2}\right)} \), we can follow these steps: ### Step 1: Express \( \frac{\sin \alpha}{\sin \beta} \) From the given equation \( 3 \sin \alpha = 5 \sin \beta \), we can express \( \frac{\sin \alpha}{\sin \beta} \) as follows: \[ \frac{\sin \alpha}{\sin \beta} = \frac{5}{3} \] **Hint:** This step involves rearranging the given equation to find the ratio of the sines of the angles. ### Step 2: Use the tangent half-angle identities We know the identities for tangent in terms of sine: \[ \tan\left(\frac{\alpha + \beta}{2}\right) = \frac{\sin\left(\frac{\alpha + \beta}{2}\right)}{\cos\left(\frac{\alpha + \beta}{2}\right)} \] \[ \tan\left(\frac{\alpha - \beta}{2}\right) = \frac{\sin\left(\frac{\alpha - \beta}{2}\right)}{\cos\left(\frac{\alpha - \beta}{2}\right)} \] ### Step 3: Use the sine addition and subtraction formulas Using the sine addition and subtraction formulas, we can express the sine terms: \[ \sin\left(\frac{\alpha + \beta}{2}\right) = \frac{1}{2} \left( \sin \alpha + \sin \beta \right) \] \[ \sin\left(\frac{\alpha - \beta}{2}\right) = \frac{1}{2} \left( \sin \alpha - \sin \beta \right) \] ### Step 4: Substitute the sine values Substituting the expressions for \( \sin \alpha \) and \( \sin \beta \): Let \( \sin \beta = x \), then \( \sin \alpha = \frac{5}{3} x \). Now substituting into the sine addition and subtraction formulas: \[ \sin\left(\frac{\alpha + \beta}{2}\right) = \frac{1}{2} \left( \frac{5}{3} x + x \right) = \frac{1}{2} \left( \frac{8}{3} x \right) = \frac{4}{3} x \] \[ \sin\left(\frac{\alpha - \beta}{2}\right) = \frac{1}{2} \left( \frac{5}{3} x - x \right) = \frac{1}{2} \left( \frac{2}{3} x \right) = \frac{1}{3} x \] ### Step 5: Calculate the ratio of tangents Now we can find the ratio: \[ \frac{\tan\left(\frac{\alpha + \beta}{2}\right)}{\tan\left(\frac{\alpha - \beta}{2}\right)} = \frac{\frac{\sin\left(\frac{\alpha + \beta}{2}\right)}{\cos\left(\frac{\alpha + \beta}{2}\right)}}{\frac{\sin\left(\frac{\alpha - \beta}{2}\right)}{\cos\left(\frac{\alpha - \beta}{2}\right)}} = \frac{\frac{4}{3} x}{\frac{1}{3} x} = \frac{4}{1} = 4 \] ### Final Answer Thus, we have: \[ \frac{\tan\left(\frac{\alpha + \beta}{2}\right)}{\tan\left(\frac{\alpha - \beta}{2}\right)} = 4 \]
Promotional Banner

Topper's Solved these Questions

Similar Questions

Explore conceptually related problems

If 3sin alpha=5sin beta, then (tan((alpha+beta)/(2)))/(tan((alpha-beta)/(2)))=

If 3sin alpha=5sin beta, then (tan((alpha+beta)/(2)))/(tan((alpha-beta)/(2)))=

If 3sin alpha=5sin beta then the value of tan((alpha+beta)/(2))tan((alpha-beta)/(2))

If sin2 alpha=4sin2 beta, show that 5tan(alpha+beta)=3tan(alpha+beta)

If 3sin alpha = sin beta!=0 , then the value of |(tan((alpha + beta)/2))/(tan((alpha-beta)/2))|

(no alpha + no beta) / (no alpha-no beta) = (tan ((alpha + beta) / (2))) / (tan ((alpha-beta) / (2)))

If 3sin alpha-sin beta ne 0, then the value of |(tan((alpha+beta)/(2)))/(tan((alpha-beta)/(2)))|

If 3 sin beta=sin(2alpha+beta) , then tan (alpha+beta)-2 tan alpha is

if tan alpha=2tan beta show that (sin(alpha+beta))/(sin(alpha-beta))=3

ALLEN-COMPOUND ANGLES-EX-01
  1. if sin x + sin^2 x = 1, then the value of cos^2 x + cos^4x is

    Text Solution

    |

  2. 2(sin^6theta+cos^6theta)-3(sin^4theta+cos^4theta) is equal to 0 (b) 1 ...

    Text Solution

    |

  3. cos^2 48^0-sin^2 12^0 is equal to

    Text Solution

    |

  4. The expression (sin 8thetacos theta-sin6 thetacos 3 theta)/(cos 2 thet...

    Text Solution

    |

  5. If 3 sin alpha=5 sin beta, then (tan((alpha+beta)/2))/(tan ((alpha-bet...

    Text Solution

    |

  6. (sin(A-C)+2sinA+sin(A+C))/(sin(B-C)+2sinB+sin(B+C)) is equal to

    Text Solution

    |

  7. (1+sin 2theta+cos 2theta)/(1+sin2 theta-cos 2 theta)=

    Text Solution

    |

  8. If A=tan6^(@) tan 42^(@) and B= cot 66^(@)cot 78^(@) then-

    Text Solution

    |

  9. If x=ycos((2pi)/3)=zcos((4pi)/3), then xy+yz+zx=

    Text Solution

    |

  10. If tanalpha=(1+2^(-x))^(-1), tan beta=(1+2^(x+1))^(-1), then alpha+bet...

    Text Solution

    |

  11. If tanA+tanB+tanC=tanAtanBtanC then

    Text Solution

    |

  12. The value of sin10^@+sin20^@+sin30^@...+sin360^@ is equal to -

    Text Solution

    |

  13. The number of real solutions of the equation sin(e^x)=2^x+2^(-x) is

    Text Solution

    |

  14. If f(x)=sin(3x)/sin x,x!=npi, then the range of values of f(x) for ...

    Text Solution

    |

  15. If cosx+cosy+cosalpha=0 and sinx+siny+sinalpha=0 then cot((x+y)/2)=

    Text Solution

    |

  16. The value of sin(pi/14)sin((3pi)/14)sin((5pi)/14) is

    Text Solution

    |

  17. 18.. Maximum and minimum value of 2sin^2theta-3sintheta+2 is

    Text Solution

    |

  18. For theta in(0,pi/2) , the maximum value of sin(theta+pi/6)+cos(theta+...

    Text Solution

    |

  19. Minimum value of the expression cos^2theta-(6 sintheta cos theta) + 3 ...

    Text Solution

    |