Home
Class 11
CHEMISTRY
If the equilibrium constant of the react...

If the equilibrium constant of the reaction
`2HI(g)hArrH_(2)(g)+I_(2)(g)` is `0.25`, find the equilibrium constant of the reaction.
`(1)/(2)H_(2)+(1)/(2)I_(2)hArrHI(g)`

Text Solution

Verified by Experts

The correct Answer is:
2
For reaction
`H_(2)(g)I_(2)(g)hArr2HI(g) K"=(1)/(0.25)=4`
For reaction
`(1)/(2)H_(2)+(1)/(2)I_(2)hArrHI(g) K"=sqrt4`
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    RESONANCE|Exercise Exercise-2 (Part-3)|34 Videos

  • CHEMICAL EQUILIBRIUM

    RESONANCE|Exercise Exercise-2 (Part-4)|6 Videos

  • CHEMICAL EQUILIBRIUM

    RESONANCE|Exercise Exercise-2 (Part-1)|28 Videos

  • CHEMICAL BONDING

    RESONANCE|Exercise Inorganic chemistry (Chemistry Bonding)|49 Videos

  • D & F-BLOCK ELEMENTS & THEIR IMPORTANT COMPOUNDS

    RESONANCE|Exercise Match the column|1 Videos

Similar Questions

Explore conceptually related problems

If the equilibrium constant of the reaction 2HI(g)hArrH_2(g)+I_2(g) is 0.25 , the equilibrium constant of the reaction 1/2H_2(g)+1/2I_2(g)hArr HI(g) will be

If the equilibrium constant of the reaction 2HI hArrH_(2) + I_(2) is 0.25 , then the equilibrium constant of the reaction H_(2) + I_(2)hArr2HI would be

If the equilibrium constant of the reaction 2HIhArr H_(2)+I_(2) is 0.25, then the equilibrium constant for the reaction, H_(2)(g)+I_(2)(g)hArr 2HI(g) would be

The value of equilibrium constant of the reaction, H(g) hArr(1)/(2) H_(2)(g) is 0.8 . The equilibrium constant of the reaction H_(2)(g) + I_(2)(g)hArr2HI(g) will be

the value of equilibrium constant for the reaction HI(g) hArr 1//2 H_(2) (g) +1//2 I_(2) (g) " is " 8.0 The equilibrium constant for the reaction H_(2) (g) +I_(2) (g) hArr 2HI(g) will be

Write the equilibrium constant of the reaction C(s)+H_(2)O(g)hArrCO(g)+H_(2)(g)

The value of equilibrium constant of the reaction. HI(g)hArr(1)/(2)H_2(g)+(1)/(2)I_2(g)is 8.0 The equilibrium constant of the reaction. H_2(g)+I_2(g)hArr2HI(g) will be

The equilibrium constant for the reaction H_(2)O(g)+CO(g)hArrH_(2)(g)+CO_(2)(g) is 0.44 at 1660 K. The equilibrium constant for the reaction 2H_(2)(g)+2CO_(2)(g)hArr 2CO(g)+2H_(2)O(g) at 1660 K is equal to

If the equilibrium constant of the reversible reaction HI(g)hArr1//2H_2(g)+1//2I_2(g) is 7.4 , the equilibrium constant for the reversible reaction 2HI(g)hArrH_2(g)+I_2(g) will be

RESONANCE-CHEMICAL EQUILIBRIUM-Exercise-2 (Part-2)
  1. A(G)+B(g)hArrC(g)+D(g) Above equilibrium is established by taking A&...

    Text Solution

    |

  2. In a reversible reaction, the forward reaction was 3 times faster than...

    Text Solution

    |

  3. If the equilibrium constant of the reaction 2HI(g)hArrH(2)(g)+I(2)(g...

    Text Solution

    |

  4. In an experiment starting with 1 mol C(2)H(5)OH, 1 mol CH(3)COOH, and ...

    Text Solution

    |

  5. For the reaction N(2)O(5)(g) 2NO(2)(g)+1//2O(2)(g) Calculate the ...

    Text Solution

    |

  6. Consider the equilibrium Ni(s)+4CO(g)hArrNi(CO)(4)(g), K(p)=0.125atm...

    Text Solution

    |

  7. For the equilibrium system FeO(s)CO(g)hArrFe(s)+CO(2)(g)(Exothermic)...

    Text Solution

    |

  8. Consider the reaction, 2CI(2)(g)+2H(2)O(g)hArr4HCI(g)+P(2)(g) DeltaH^(...

    Text Solution

    |

  9. For given simultaneous reaction: X(s)hArrA(g)+B(s)+C(g) K(P(1))=500a...

    Text Solution

    |

  10. If a mixture 0.4 "mole" H(2) "and" 0.2 mole Br(2) is heated at 700K at...

    Text Solution

    |

  11. 2 mole of PCI(5) were heated in a 5 litre vessel. It dissociated. 80% ...

    Text Solution

    |

  12. A(2)(g) and B(2)(g) having partial pressures 60mm of Hg & 45mm of Hg r...

    Text Solution

    |

  13. When C(2)H(5)OH "and" CH(3)COOH are mixed in equivaient proportion, eq...

    Text Solution

    |

  14. At equilibrium of the reaction , N(2)O(4)(g) hArr 2NO(2)(g) the ob...

    Text Solution

    |

  15. The vapour density of N(2)O(4) at a certain temperature is 30. Calcula...

    Text Solution

    |

  16. Solid ammonium carbamate dissociates to give ammonia and carbon dioxid...

    Text Solution

    |

  17. In the reaction C(s)+CO(2)(g) hArr 2CO(g), the equilibrium pressure is...

    Text Solution

    |

  18. Two solids A and D dissociates into gaseous products as follows C(s)...

    Text Solution

    |

  19. NH(4)HS(s)hArrNh(3)(g)+H(2)S(g) K(P(1) NH(3)(g)hArr(1)/(2)N(2)(g)+(3...

    Text Solution

    |

  20. Consider (i) C(s)+O(2)hArrCO(2)(g) K(P(2)=(7)/(8) (ii) 2C(s)+O(2)h...

    Text Solution

    |