Home
Class 11
CHEMISTRY
Describe the method, which can be used t...

Describe the method, which can be used to separate two compounds with different solubilities in a solvent S.

Promotional Banner

Topper's Solved these Questions

  • ORGANIC CHEMISTRY - SOME BASIC PRINCIPLES AND TECHNIQUES

    NCERT TELUGU|Exercise EXERCISES|39 Videos

  • HYDROGEN

    NCERT TELUGU|Exercise EXERCISE|36 Videos

  • ORGANIC HALOGEN COMPOUNDS

    NCERT TELUGU|Exercise Questions|25 Videos

Similar Questions

Explore conceptually related problems

Which type of compounds are more soluble in polar solvents ?

The method used to separate stones from rice is …….

What is the method useful to separate two components of a mixture having different particle size ?

Are the methods used to separate the components the same in all instances?

Chromatography is the method used to separate

Which method is suitable to separate salt from sea water?

Distillation is used to separate liquids which differ in their b, pt by

Is chromatography used only to separate coloured compounds?

Describe the Dewar's method of separation of noble gases.

Which of the following method used to separate two miscible liquids?

NCERT TELUGU-ORGANIC CHEMISTRY - SOME BASIC PRINCIPLES AND TECHNIQUES -EXERCISES
  1. Explain the terms Inductive and Electromeric effects. Which electron d...

    Text Solution

    |

  2. Give a brief description of the principles of the following techniques...

    Text Solution

    |

  3. Describe the method, which can be used to separate two compounds with ...

    Text Solution

    |

  4. What is the difference between distillation, distillation under reduce...

    Text Solution

    |

  5. Discuss Lassigne's test.

    Text Solution

    |

  6. Differentiate between the principal of estimation of nitrogen in an or...

    Text Solution

    |

  7. Explain the estimation of phosphorus and sulphur present in the organi...

    Text Solution

    |

  8. Explain the principle of chromatography.

    Text Solution

    |

  9. Why is nitric acid added to sodium extract before adding silver nitrat...

    Text Solution

    |

  10. Explain the reason for the fusion of an organic compound with metallic...

    Text Solution

    |

  11. Name a suitable technique of separation of the components from a mixtu...

    Text Solution

    |

  12. Explain why an organic liquld vaporizes at a temperature below its bol...

    Text Solution

    |

  13. Will C Cl(4) give white precipitate of AgCl on heating it with silver ...

    Text Solution

    |

  14. Why is a solution of potassium hydroxide used to absorb carbon dioxide...

    Text Solution

    |

  15. Why is it necessary to use acid and not sulphuric acid for acidificati...

    Text Solution

    |

  16. An organic compound contains 69% carbon and 4.8% hydrogen, the remaind...

    Text Solution

    |

  17. A sample of 0.50 g of an organic compound was treated according to Kje...

    Text Solution

    |

  18. 0.3780 g of an organic chloro compound gave 0.5740 g of silver chlorid...

    Text Solution

    |

  19. In the estimation of sulphur by Carius method, 0.468 g of an organic s...

    Text Solution

    |

  20. In the organic compound CH(2)=CH-CH(2)-CH(2)-C-=CH, the pair of hydrid...

    Text Solution

    |