Home
Class 14
MATHS
If (11)^a = (19)^b = (209)^c then the co...

If `(11)^a = (19)^b = (209)^c` then the correct relation is :

A

`ab = (c)^(ab)`

B

`a^b = c`

C

`ab = c(a + b)`

D

None of these

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we start with the given equation: \[ (11)^a = (19)^b = (209)^c = k \] where \( k \) is some constant. ### Step 1: Express each base in terms of \( k \) From the equation, we can express each base in terms of \( k \): 1. For \( 11^a = k \): \[ k = 11^a \implies k^{\frac{1}{a}} = 11 \] 2. For \( 19^b = k \): \[ k = 19^b \implies k^{\frac{1}{b}} = 19 \] 3. For \( 209^c = k \): \[ k = 209^c \implies k^{\frac{1}{c}} = 209 \] ### Step 2: Relate the bases using the multiplication property We know that \( 11 \times 19 = 209 \). Therefore, we can write: \[ 11 \cdot 19 = 209 \] Substituting the expressions we found for \( k \): \[ k^{\frac{1}{a}} \cdot k^{\frac{1}{b}} = k^{\frac{1}{c}} \] ### Step 3: Combine the exponents Using the property of exponents, we can combine the left side: \[ k^{\frac{1}{a} + \frac{1}{b}} = k^{\frac{1}{c}} \] ### Step 4: Set the exponents equal to each other Since the bases are the same, we can set the exponents equal to each other: \[ \frac{1}{a} + \frac{1}{b} = \frac{1}{c} \] ### Step 5: Rearranging the equation To find a relation among \( a \), \( b \), and \( c \), we can rearrange the equation: \[ \frac{1}{c} = \frac{1}{a} + \frac{1}{b} \] This can be rewritten as: \[ \frac{1}{c} = \frac{b + a}{ab} \] Thus, we can express \( c \) in terms of \( a \) and \( b \): \[ c = \frac{ab}{a + b} \] ### Final Relation From the above steps, we conclude that the correct relation is: \[ c = \frac{ab}{a + b} \]
Promotional Banner

Topper's Solved these Questions

  • FUNDAMENTALS

    ARIHANT SSC|Exercise LEVEL 2|123 Videos
  • FUNDAMENTALS

    ARIHANT SSC|Exercise FINAL ROUND|116 Videos
  • FUNDAMENTALS

    ARIHANT SSC|Exercise EXERCISE - MISCELLANEOUS|140 Videos
  • FUNCTIONS AND GRAPH

    ARIHANT SSC|Exercise Final Round|40 Videos
  • GEOMETRY

    ARIHANT SSC|Exercise EXERCISE(LEVEL 2)|52 Videos

Similar Questions

Explore conceptually related problems

If A,B and C are in A.P then correct relation

If HCF (209, 737) = 11 and LCM (209, 737) = 209 x, then the value of x is :

If A,B,C are in A.P., then correct relation is cot A=(sin B+sin C)/(cos C+sin B)

If A={a,b,c}, then the relation R={(b,c)} on A is

Let a,b,c>0 such that a>b>c and a+c>2b .If In(a+c)+In(a-2b+c)=2In(a-c) then which of the following relation is(are) correct?

The rate equation for the reaction 2A+B rarr C is found to be: rate = k[A][B] . The correct statement in relation of this reaction is that

The rate equation for the reactions 2A + B to C is found to be: rate = k[A][B] . The correct statement in relation to this reaction is that the

If 19x^2 = 100^2 - 90^2 , then find the value of x A. 10 B. 9 C. 11 D. 12

ARIHANT SSC-FUNDAMENTALS -LEVEL 1
  1. If a fraction is divided by its reciprocal and then multiplied by itse...

    Text Solution

    |

  2. Mr. A starts a business with an investment of Rs. 28,000. Mr. B joins ...

    Text Solution

    |

  3. If (11)^a = (19)^b = (209)^c then the correct relation is :

    Text Solution

    |

  4. The remainder when (2^(54) - 1) is divided by 9 is :

    Text Solution

    |

  5. A number 1 < N < 100 is such that it is a perfect square and perfect c...

    Text Solution

    |

  6. The product of the digits of a three digit number which is a perfect s...

    Text Solution

    |

  7. A natural number N is such that N = a^2 = b^4 = c^8 , where a, b, c ar...

    Text Solution

    |

  8. The possible value of |x| + |x - 1| = 2 is :

    Text Solution

    |

  9. If (pqr)^2 = (ijk pqr), where i,j,k,p,q,r in W, are pqr and ijkpqr are...

    Text Solution

    |

  10. 3^(6n) + 4^(6n) is necessarily divisible by 25 when :

    Text Solution

    |

  11. The number of zeros at the end of 100!, is

    Text Solution

    |

  12. the greatest power of 3, when 41 ! Is expressed in prime factors :

    Text Solution

    |

  13. A two digit number is such that it is the product of the two distinct ...

    Text Solution

    |

  14. The value of the expression 7777 + 7777 xx 7777 xx (5 div 77) xx (1...

    Text Solution

    |

  15. The sum and difference of a number with its reciprocal are 113/56 and ...

    Text Solution

    |

  16. If 4 is added to the numerator of a fraction, it becomes 1/3 and if 3 ...

    Text Solution

    |

  17. In an opera house, there are 7777 chairs to be placed, but the organis...

    Text Solution

    |

  18. If p^r . P^(-1) . P^s = (sqrt(p^3))^(2) and p^(3//2).p^r = p^s.p^(-1//...

    Text Solution

    |

  19. If 5^(-k) = 1/l, then the value of 5^(3k) is equal to :

    Text Solution

    |

  20. 5^(x - 1) + 5^x + 5^(x + 1) = 775 then the value of x for every positi...

    Text Solution

    |