NCERT BANGLISH-BASIC CONCEPTS OF ORGANIC CHEMISTRY-Questions
- Write IUPAC name of the following (a) CH(3)-underset(OH)underset("| ...
Text Solution
|
- Write IUPAC name of the following (b) CH(3)-overset(CH(3))overset("|...
Text Solution
|
- Write IUPAC name of the following (c ) CH(3)-underset(CH(3))underset...
Text Solution
|
- Write IUPAC name of the following (d) CH(3)-overset(CH(3))overset("|...
Text Solution
|
- Write IUPAC name of the following (e) CH(2)=CH-COCH(2)CH(3)
Text Solution
|
- Write IUPAC name of the following (f) CH(3)CH(2)CHO
Text Solution
|
- Write IUPAC name of the following (g) CH(3)-underset(CH(3))underset...
Text Solution
|
- Write IUPAC name of the following (h) CH(3)CH(2)OCH(2)CH(3)
Text Solution
|
- Write IUPAC name of the following (i) CH(3)OCH(2)CH(2)CH(3)
Text Solution
|
- Write IUPAC name of the following (j) CH(3)-O-underset(CH(3))underse...
Text Solution
|
- Write IUPAC name of the following (k) CH(3)CH(2)CH(2)CH(2)NH(2)
Text Solution
|
- Explain briefly on the following Homolytic and heterolytic fission.
Text Solution
|
- Explain briefly on the following Substitution reaction.
Text Solution
|
- Explain briefly on the following Addition reaction.
Text Solution
|
- Explain briefly on the following Elimination reaction.
Text Solution
|
- Explain briefly on the following Polymerisation reaction.
Text Solution
|
- Explain briefly on the following Condensation reaction.
Text Solution
|
- Explain briefly on the following Hydrolysis.
Text Solution
|
- Explain briefly on the following Reduction and oxidation reactions.
Text Solution
|
- Explain briefly on the following Electrophilic and Nucleophilic reag...
Text Solution
|