Home
Class 12
CHEMISTRY
NH(4)HS(s)hArrNH(3(g))+H(2)S(g) The eq...

`NH_(4)HS_(s)hArrNH_(3(g))+H_(2)S_(g)`
The equilibrium pressure at `25_(@)`C is 0.660 atm What is `K_(p)` for reactoin ?
`NH_(4)NH_(s)hArrNH_(3(g))+H_(2)S_(g)`

Promotional Banner

Similar Questions

Explore conceptually related problems

NH_(4)HS(s)hArrNH_(3)(g)+H_(2)S(g) The3 equilibrium pressure at 25^(@)C is 0.660 atm . What is K_(p) for the reaction ?

NH_(4)HS(s)hArrNH_(3)(g)+H_(2)S(g) The equilibrium pressure at 25^(@)C is 0.660 atm . What is K_(p) for the reaction?

NH_(4)HS(s)hArrNH_(3)(g)+H_(2)S(g) The equilibrium pressure at 25 degree Celsius is 0.660 atm . What is Kp for the reaction ?

For NH_(4)HS(s)hArr NH_(3)(g)+H_(2)S(g) If K_(p)=64atm^(2) , equilibrium pressure of mixture is

For NH_(4)HS(s)hArr NH_(3)(g)+H_(2)S(g) If K_(p)=64atm^(2) , equilibrium pressure of mixture is

For NH_4HS(s)hArrNH_3(g)+H_2S(g) , if K_p = 64 atm^2 , equilibrium pressure of mixture is

A definite amount of solid NH_(4)HS is placed in a flask already containing ammonia gas at a certain temperature and 0.1 atm pressure. NH_(4)HS decompses to give NH_(3) and H_(2)S and at equilibrium total pressure in flask is 1.1 atm. If the equilibrium constant K_(P) for the reaction NH_(4)HS(s) iff NH_(3)(g)+H_(2)S(g) is represented as zxx10^(-1) then find the value of z.