Write the IUPAC name of the following compound:
`CH_(3)-underset(Br)underset(|)CH-CH_(2)-underset(Cl)underset(|)CH-CH_(3)`

Explanation

To write the IUPAC name of the given compound, we can follow these steps:

### Step-by-Step Solution

1. **Identify the Structure**: The compound is represented as `CH3-CH(Br)-CH2-CH(Cl)-CH3`. This indicates a chain of carbon atoms with bromine (Br) and chlorine (Cl) substituents.

2. **Determine the Longest Carbon Chain**: The longest continuous carbon chain in the compound consists of 5 carbon atoms. Therefore, the base name of the compound will be derived from pentane (C5).

...