Home
Class 12
CHEMISTRY
Write the IUPAC name of the given compou...

Write the IUPAC name of the given compound :
`CH_(3)-underset(CH_(3))underset(|)CH-CH_(2)-O-CH_(2)-CH_(3)`

Text Solution

AI Generated Solution

To determine the IUPAC name of the given compound, we will follow these steps: ### Step 1: Identify the Structure The compound is given as `CH3-CH(CH3)-CH2-O-CH2-CH3`. We can rewrite this for clarity: - The structure can be depicted as: ``` CH3 | ...
Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of the following compound: CH_(3)underset(CH_(3))underset(|)-CH-CHO

The IUPAC name of the compound is CH_(3)-underset(CH_(3))underset(|)(CH)-CH_(2)-CH(OH)-CH_(2)

Write the IUPAC name of the compound : CH_(3)-O-CH_(2)-underset(CH_(3))underset(|)(CH)-CH_(2)-CH_(3)

Write the IUPAC name of the following compound : CH_(3)-underset(CH_(3))underset(|)(CH)-C-=C-CH_(3)

The IUPAC name of given compound is CH_3-underset(CH_2CH_3)underset(|)(CH)-CHO

Give the IUPAC name of the compound : CH_(2)=CH-underset(OH)underset(|)(CH)-CH_(2)-CH_(2)-CH_(3) .

Give the IUPAC name of the following compound: H_(2)C=CH-underset(OH)underset(|)(CH)-CH_(2)-CH_(2)-CH_(3)

Write the IUPAC name of the following compound: CH_(3)-O-CH_(2)-underset(CH_(3))underset(|)(CH)-CH_(3)

Give the IUPAC name of the compound CH_3-CH_2-underset(CH_3)underset(|)N-CH_3

Give the IUPAC name of the compound CH_3-underset(OCH_3)underset(|)CH-CH_2-CH_3