Home
Class 11
CHEMISTRY
CuSO(4).5H(2)O(s)hArrCuSO(4). 3H(2)O(s)+...

`CuSO_(4).5H_(2)O(s)hArrCuSO_(4). 3H_(2)O(s)+2H_(2)O(g), K_(p)=4xx10^(-4)atm^(2)` If the vapour pressure of water is 38 toor then percentage of relatative humidity is :(Assume all data at constant temperture)

A

4

B

10

C

40

D

none of these

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we need to calculate the percentage of relative humidity based on the given equilibrium reaction and the vapor pressure of water. Let's break down the steps: ### Step-by-Step Solution: 1. **Write the Reaction and Identify Kp:** The reaction given is: \[ \text{CuSO}_4 \cdot 5\text{H}_2\text{O} (s) \rightleftharpoons \text{CuSO}_4 \cdot 3\text{H}_2\text{O} (s) + 2\text{H}_2\text{O} (g) \] The equilibrium constant \( K_p \) is given as: \[ K_p = 4 \times 10^{-4} \, \text{atm}^2 \] 2. **Understand the Expression for Kp:** Since solids do not contribute to the equilibrium expression, we only consider the gaseous products: \[ K_p = \frac{(P_{\text{H}_2\text{O}})^2}{1} = (P_{\text{H}_2\text{O}})^2 \] Therefore, we have: \[ P_{\text{H}_2\text{O}}^2 = 4 \times 10^{-4} \, \text{atm}^2 \] 3. **Calculate the Partial Pressure of Water:** Taking the square root to find \( P_{\text{H}_2\text{O}} \): \[ P_{\text{H}_2\text{O}} = \sqrt{4 \times 10^{-4}} = 2 \times 10^{-2} \, \text{atm} = 0.02 \, \text{atm} \] 4. **Convert Vapor Pressure of Water from Torr to Atmosphere:** The vapor pressure of water is given as 38 torr. To convert this to atmospheres: \[ P_{\text{vapor}} = \frac{38 \, \text{torr}}{760 \, \text{torr/atm}} = \frac{1}{20} \, \text{atm} = 0.05 \, \text{atm} \] 5. **Calculate Relative Humidity:** The formula for relative humidity is: \[ \text{Relative Humidity} = \left( \frac{P_{\text{H}_2\text{O}}}{P_{\text{vapor}}} \right) \times 100 \] Substituting the values: \[ \text{Relative Humidity} = \left( \frac{0.02 \, \text{atm}}{0.05 \, \text{atm}} \right) \times 100 = \left( \frac{2}{5} \right) \times 100 = 40\% \] 6. **Final Answer:** The percentage of relative humidity is: \[ \text{Relative Humidity} = 40\% \]
Promotional Banner

Similar Questions

Explore conceptually related problems

CuSO_(4) .5H_(2)O_((g)) hArr CuSO_(4), 3H_(2)O_((s)) + 2H_(2) O_((g)) , K_(p) = 4 xx 10^(-4) atm^(2) . If the vapour pressure of wateris 38 torr then percentage of relative humidity is: (Assume all data at constant temperature)

CuSO_(4).5H_(2)O(s)hArrCuSO_(4).3H_(2)O(s)+2H_(2)O(s) K_(P)=0.4xx10^(-3) atm^(2) Which of following sttement are correct:

In CuSO_(4) · 5H_(2)O

For equilibrium ZnSO_(4).7H_(2)O(s)hArrZnSO_(4).2H_(2)O(s)+5H_(2)O(g) K_(P)=56.25xx10^(-10) atm^(5) and vapour pressure of water is 22.8 torr at 298K.ZnSO_(4).7H_(2)O(s) is efflorescent (lose water) when relative humidity is [5sqrt56.25=2.23]

For the equilibrium CuSO_(4)xx5H_(2)O(s)hArrCuSO_(4)xx3H_(2)O(s) + 2H_(2)O(g) K_(p) = 2.25xx10^(-4)atm^(2) and vapour pressure of water is 22.8 torr at 298 K. CuSO_(4) . 5H_(2)O(s) is efflorescent (i.e., losses water) when relative humidity is :

Na_(2)SO_(4).10H_(2)O(s)hArrNa_(2)SO_(4).5H_(2)O(g) K_(P)=2.43xx10^(-8) atm^(5) incorrect statement is-

For the reaction CuSO_(4).5H_(2)O(s) hArr CuSO_(4).3H_(2)O(s)+2H_(2)O(g) Which one is the correct representation?

For NH_(4)HS(s)hArr NH_(3)(g)+H_(2)S(g) If K_(p)=64atm^(2) , equilibrium pressure of mixture is

Draw structure CuSO_(4).5H_(2)O

H_(4)underline(P_(2))O_(7)+H_(2)O to 2H_(3)PO_(4)