IUPAC name of `CH_(3)CH_(2)CH_(2)underset(CH_2OH)underset(|)(C)H- CH_(2)CH_(3)` is

Options

A. 3-propylbutan-1-ol
B. 2-ethylpentan-1-ol
C. 3-methyl hydroxyhexane
D. 2-ethyl-2-propyl ethanol.

Explanation

To determine the IUPAC name of the compound `CH3CH2CH2(CH2OH)(C)H-CH2CH3`, we can follow these steps:

### Step 1: Identify the Structure
First, let's write out the structure of the compound based on the provided formula. The compound can be interpreted as:
- A straight chain of carbon atoms with a hydroxymethyl group (–CH2OH) and an ethyl group (–C2H5) attached.

### Step 2: Determine the Longest Carbon Chain
Next, we need to find the longest continuous carbon chain that includes the functional group (the hydroxyl group in this case).
- If we consider the longest chain that includes the –CH2OH group, we can count the carbon atoms.

### Step 3: Number the Carbon Chain
We will number the carbon chain starting from the end nearest to the functional group (the –CH2OH group) to give it the lowest possible number:
1. Start from the end with the –CH2OH group.
2. Continue numbering until you reach the other end of the chain.

### Step 4: Identify Substituents
After numbering the chain, identify any substituents:
- In this case, we have an ethyl group (–C2H5) as a substituent.

### Step 5: Write the IUPAC Name
Using the information gathered:
- The longest chain has 5 carbon atoms (pentane).
- There is an ethyl group on the second carbon.
- The hydroxyl group is on the first carbon.

Thus, the IUPAC name can be constructed as follows:
- The name will be "2-ethyl-1-pentanol".

### Final Answer
The IUPAC name of the compound is **2-ethyl-1-pentanol**.

---