Terylene is a condensation polymer of ethylene glycol and

Options

A. bernzoic acid
B. phthalic acid
C. tetraphthalic acid
D. salicylic acid .

Answer

To answer the question "Terylene is a condensation polymer of ethylene glycol and...," we can follow these steps:

### Step-by-Step Solution:

1. **Identify the Components of Terylene**:
Terylene is a type of polyester. It is formed from two main monomers: ethylene glycol and terephthalic acid.

2. **Understand the Polymerization Process**:
Terylene is synthesized through a condensation polymerization reaction. In this process, two monomers react to form a polymer while eliminating a small molecule, typically water (H2O).

3. **Write the Chemical Structures**:
- **Ethylene Glycol**: Its structure is HO-CH2-CH2-OH.
- **Terephthalic Acid**: Its structure is HOOC-C6H4-COOH (where C6H4 represents a benzene ring).

4. **Describe the Reaction**:
When ethylene glycol reacts with terephthalic acid, the hydroxyl (-OH) group of ethylene glycol reacts with the carboxyl (-COOH) group of terephthalic acid. This reaction leads to the formation of an ester bond and releases a molecule of water.

5. **Write the Resulting Polymer Structure**:
The repeating unit of Terylene can be represented as:
- O-CH2-CH2-O-C(=O)-C6H4-C(=O)-O
This structure shows the alternating units of ethylene glycol and terephthalic acid.

6. **Conclusion**:
Therefore, Terylene is a condensation polymer formed from ethylene glycol and terephthalic acid.

### Final Answer:
Terylene is a condensation polymer of ethylene glycol and terephthalic acid.