Polymer which has amide linkage is

Options

A. nylon-6,6
B. terylene
C. teflon
D. bakelite

Answer

To solve the question "Polymer which has amide linkage is," we need to identify the polymer that contains an amide linkage from the given options. Here’s a step-by-step breakdown of the solution:

### Step 1: Understand Amide Linkage
An amide linkage is characterized by the functional group -C(=O)NH-. This means that there is a carbonyl group (C=O) directly attached to a nitrogen atom (N) which is also connected to a hydrogen atom or an alkyl group.

**Hint:** Look for the presence of the -C(=O)NH- structure in the polymer options.

### Step 2: Analyze Each Option
We will evaluate each polymer option to check for the presence of amide linkages.

#### Option 1: Nylon 6-6
- Nylon 6-6 is synthesized from hexamethylenediamine and adipic acid.
- The reaction involves the formation of an amide bond through the removal of water (condensation reaction).
- The structure of nylon 6-6 contains the amide linkage:
- NH(CH2)6NH-C(=O)(CH2)4C(=O)
- Therefore, this option contains amide linkages.

**Hint:** Check the components of the polymer and see if they form amide bonds.

#### Option 2: Pteriline
- Pteriline is formed from ethylene glycol and adipic acid.
- The reaction leads to the formation of ester linkages, not amide linkages.
- The structure does not contain the -C(=O)NH- group.

**Hint:** Identify the type of bond formed during polymerization (amide vs ester).

#### Option 3: Teflon
- Teflon is made from tetrafluoroethylene (CF2=CF2).
- The polymerization of Teflon does not involve any amide linkages; it consists solely of carbon-fluorine bonds.
- There are no amide linkages present.

**Hint:** Look for the functional groups in the polymer structure.

#### Option 4: Bakelite
- Bakelite is a phenolic resin formed from phenol and formaldehyde.
- The structure does not contain any amide linkages; it primarily consists of ether and carbon-carbon bonds.

**Hint:** Examine the chemical structure for the presence of amide linkages.

### Step 3: Conclusion
After analyzing all the options, we conclude that the polymer which has an amide linkage is **Nylon 6-6**.

**Final Answer:** Nylon 6-6