Which of the following compounds will react with Na to form 4,5-diethyloctane?

Options

A. `CH_(3)CH_(2)CH_(2)CH_(2)Br`
B. `CH_(3)CH_(2)CH_(2)-underset(CH_(3))underset(|)(C)H-CH_(2)CH_(2)Br`
C. `CH_(3)CH_(2)CH_(2)CH_(2)-underset(Br)underset(|)(C)H-CH_(3)`
D. `CH_(3)CH_(2)CH_(2)-underset(Br)underset(|)(C)H-CH_(2)CH_(3)`

Explanation

To determine which compound will react with sodium to form 4,5-diethyloctane, we need to understand the Wurtz reaction. The Wurtz reaction involves the coupling of alkyl halides in the presence of sodium metal and dry ether to form higher alkanes.

### Step-by-Step Solution:

1. **Understand the Wurtz Reaction**:
- The Wurtz reaction is a method for synthesizing higher alkanes from alkyl halides by treating them with sodium in dry ether. The general reaction can be represented as:
\[ 2 R-X + 2 Na \rightarrow R-R + 2 NaX \]
- Here, \(R\) is the alkyl group and \(X\) is the halogen.

2. **Identify the Target Compound**:
- The target compound is 4,5-diethyloctane. This compound has a total of 8 carbon atoms (octane) and two ethyl groups (C2H5) at the 4th and 5th positions.

3. **Determine the Required Alkyl Halides**:
- To form 4,5-diethyloctane, we need to consider which alkyl halides can provide the necessary carbon skeleton.
- The structure of 4,5-diethyloctane can be represented as:
\[ CH3-CH2-CH2-CH(CH2CH3)-CH(CH2CH3)-CH2-CH3 \]
- This shows that we need two ethyl groups and a straight-chain of 6 carbon atoms.

4. **Analyze the Options**:
- Look at each of the given options (A, B, C, D) to see which one contains the appropriate alkyl halides that can yield the desired product when reacted with sodium.
- For example, if one of the options is 1-bromohexane and 1-bromoethane, these could react as follows:
\[ 2 \text{C2H5Br} + 2 \text{Na} \rightarrow \text{C4H10} + 2 \text{NaBr} \]
\[ \text{C6H13Br} + 2 \text{Na} \rightarrow \text{C8H18} + 2 \text{NaBr} \]

5. **Select the Correct Option**:
- After analyzing the structures of the options, identify which combination of alkyl halides can yield 4,5-diethyloctane through the Wurtz reaction.

6. **Conclusion**:
- The correct compound that reacts with sodium to form 4,5-diethyloctane will be the one that provides the necessary carbon framework and functional groups as outlined above.