Home
Class 10
CHEMISTRY
How would you name the following compoun...

How would you name the following compounds?
`CH_3-CH_2-Br`

Promotional Banner

Topper's Solved these Questions

  • ACIDS, BASES AND SALTS

    MBD|Exercise EXAMPLE|178 Videos

  • CHKHOICAL REACTIONS AND EQUATIONS

    MBD|Exercise Example|133 Videos

Similar Questions

Explore conceptually related problems

Give the iupac names of the following compound : CH3-CH2-C(Cl)(Br)-CH2-CH2-CH2-CH3

Write the names of the compounds CH_3-CH_2-Br

Write the IUPAC name of the following compound : (CH_3)_3C CH_2Br

Write IUPAC name of the following compound : (CH_3)_3CCCH_2Br

Assign IUPAC name of the following compounds: CH_3-CH_2-underset(Cl)underset(|)(CH)-COOH

Give the IUPAC name of the following organic compounds : CH_3-CH_2-underset(CH_3)underset(|)overset(CONH_2)(CH)-CH_2-CHO

Write the IUPAC names of the following compounds : (CH_3)_3 C CH_2 Br

MBD-CARBON AND ITS COMPOUNDS-EXAMPLE
  1. Draw the sturctures for following compounds: Butanone

    Text Solution

    |

  2. Draw the sturctures for following compounds: Hexanal

    Text Solution

    |

  3. How would you name the following compounds? CH3-CH2-Br

    Text Solution

    |

  4. How would you name the following compounds?

    Text Solution

    |

  5. How would you name the following compounds?

    Text Solution

    |

  6. Why is the conversion of ethanol to ethanoic acid an oxidation reactio...

    Text Solution

    |

  7. A mixture of oxygen and ethyne is brunt for welding. can you tell why ...

    Text Solution

    |

  8. How would you distinguish experimentally between an alcohol and a carb...

    Text Solution

    |

  9. What are oxidising agents?

    Text Solution

    |

  10. Would you be able to check if water is hard using a detergent?

    Text Solution

    |

  11. People use variety of methods to wash clothes usually after adding the...

    Text Solution

    |

  12. Ethane, with the molecular formula C2 H6 has:

    Text Solution

    |

  13. Butanone is a four- carbon compound with the functional group:

    Text Solution

    |

  14. While cooking, if the bottom of the vesel is getting blackened on the ...

    Text Solution

    |

  15. Explain the nature of the covalent bond using the bond formation in CH...

    Text Solution

    |

  16. Draw the electron dot structures for: ethanoic acid.

    Text Solution

    |

  17. Draw the electron dot structures for:H2S

    Text Solution

    |

  18. Draw the electron dot structures for: propanone

    Text Solution

    |

  19. Draw the electron dot structures for: F2

    Text Solution

    |

  20. What is an homologous series: explain with an example.

    Text Solution

    |