Home
Class 14
MATHS
If (11)^a = (19)^b = (209)^c then the co...

If `(11)^a = (19)^b = (209)^c` then the correct relation is:

A

`ab = (c )^(ab)`

B

`a^b = c`

C

ab = (ca+b)

D

none of these

Text Solution

AI Generated Solution

The correct Answer is:
To solve the equation \( (11)^a = (19)^b = (209)^c \), we can set all three expressions equal to a common variable \( K \). Thus, we have: 1. \( 11^a = K \) 2. \( 19^b = K \) 3. \( 209^c = K \) From these equations, we can express \( 11 \), \( 19 \), and \( 209 \) in terms of \( K \): \[ 11 = K^{1/a} \] \[ 19 = K^{1/b} \] \[ 209 = K^{1/c} \] Next, we can multiply the first two equations: \[ 11 \times 19 = K^{1/a} \times K^{1/b} = K^{(1/a) + (1/b)} \] Now, we know that \( 11 \times 19 = 209 \): \[ 209 = K^{(1/a) + (1/b)} \] Since we also have \( 209 = K^{1/c} \), we can set these equal to each other: \[ K^{(1/a) + (1/b)} = K^{1/c} \] Since the bases are the same, we can equate the exponents: \[ \frac{1}{a} + \frac{1}{b} = \frac{1}{c} \] Now, let's multiply through by \( abc \) to eliminate the denominators: \[ bc + ac = ab \] Rearranging gives us: \[ ab = ac + bc \] This can be rewritten as: \[ ab - ac - bc = 0 \] Thus, we have derived the relationship between \( a \), \( b \), and \( c \): \[ ab = ac + bc \]
Promotional Banner

Topper's Solved these Questions

  • MENSURATION

    QUANTUM CAT|Exercise QUESTION BANK|449 Videos
  • PERCENTAGES

    QUANTUM CAT|Exercise QUESTION BANK|271 Videos

Similar Questions

Explore conceptually related problems

If A,B and C are in A.P then correct relation

If HCF (209, 737) = 11 and LCM (209, 737) = 209 x, then the value of x is :

If A,B,C are in A.P., then correct relation is cot A=(sin B+sin C)/(cos C+sin B)

If A={a,b,c}, then the relation R={(b,c)} on A is

Let a,b,c>0 such that a>b>c and a+c>2b .If In(a+c)+In(a-2b+c)=2In(a-c) then which of the following relation is(are) correct?

For the reaction 2A + 3B + 3/2C rarr 3P the correct relation between rate of reaction of species A,B,C is

The rate equation for the reaction 2A+B rarr C is found to be: rate = k[A][B] . The correct statement in relation of this reaction is that

The rate equation for the reactions 2A + B to C is found to be: rate = k[A][B] . The correct statement in relation to this reaction is that the

QUANTUM CAT-NUMBER SYSTEM-QUESTION BANK
  1. If a fraction is divided by its reciprocal and then mltiplied by itsel...

    Text Solution

    |

  2. A perfect square less than 500 is such that when a prime number p1 is ...

    Text Solution

    |

  3. If (11)^a = (19)^b = (209)^c then the correct relation is:

    Text Solution

    |

  4. The remainder when ('(2)^(54)' -1) is divided by 9 is :

    Text Solution

    |

  5. A number 1 lt N lt 100 is such that it is a perfect square and perfect...

    Text Solution

    |

  6. The product of the digits of a three digit number which is perfect squ...

    Text Solution

    |

  7. A natural number N is such that N = a^2 = b^4 = c^8 , where a, b, c ar...

    Text Solution

    |

  8. The possible value of |x| + |x - 1| = 2 is :

    Text Solution

    |

  9. If (pqr)^2 = (ijk pqr), where i,j,k,p,q,r in W, are pqr and ijkpqr are...

    Text Solution

    |

  10. 3^(6n) + 4^(6n) is necessarily divisible by 25 when :

    Text Solution

    |

  11. The number of zeros at the end of 100! Is :

    Text Solution

    |

  12. the greatest power of 3, when 41 ! Is expressed in prime factors :

    Text Solution

    |

  13. A two digit number is such that it is the product of the two distinct ...

    Text Solution

    |

  14. The value of the expression 7777 + 7777 xx 7777 xx (5 div 77) xx (1...

    Text Solution

    |

  15. The sum and difference of a number with it sreciprocal are 113/56 and ...

    Text Solution

    |

  16. If 4 is added to the numerator of fraction, it becomes 1/3 and if 3 is...

    Text Solution

    |

  17. In an opera house, there are 7777 chairs to be placed, but the organis...

    Text Solution

    |

  18. If p^r . P^(-1) . P^s = (sqrt(p^3))^(2) and p^(3//2).p^r = p^s.p^(-1//...

    Text Solution

    |

  19. If 5^(-k) = 1/t, then the value of 5^(3k) is equal to :

    Text Solution

    |

  20. 5^(x-1) + 5^x + 5^(x+1) = 775 then the value of x for every positive i...

    Text Solution

    |