Home
Class 11
CHEMISTRY
What is octane number? How octane number...

What is octane number? How octane number of fuels can be improved?

Promotional Banner

Topper's Solved these Questions

  • GOC-II & III

    PATHFINDER|Exercise QUESTION BANK|144 Videos

  • HYDROGEN

    PATHFINDER|Exercise QUESTION BANK|77 Videos

Similar Questions

Explore conceptually related problems

What is bio fuel?

What is fuels?

What is the significance of octane number of a sample of gasoline?

What is the cause of decreasing number of lion? How it can be conserved?

What is fossil fuel?

A number of organic compounds can be decomposed by

How many numbers of 4 - digit greater than 6,000 can be formed with the digits 3,4,5,6,8? (No digit is repeated in any numbers . ) How manay of these numbers so formed are odd?

What is the maximum number of electrons that can be accommodated in the subshell with l=3?

What is the maximum number of electrons that can be accommodated in an orbital with m=+3?

PATHFINDER-HYDROCARBONS-QUESTION BANK
  1. Give reason for the following : In monoalkylation of benzene with an...

    Text Solution

    |

  2. Give reason for the following: Nitrobenzene, but not benzene, is use...

    Text Solution

    |

  3. What is octane number? How octane number of fuels can be improved?

    Text Solution

    |

  4. Name the antidote of Lewisite.

    Text Solution

    |

  5. Draw the Newman projection of less stable and most stable staggered fo...

    Text Solution

    |

  6. Tert - Butylbenzene does not give benzoic acid on treatment with acidi...

    Text Solution

    |

  7. Transfer Acetylene to chloroprene.

    Text Solution

    |

  8. A hydrocarbon (X) has the molecular formula C8H10. It does not decolou...

    Text Solution

    |

  9. Identify A, B and C of the following reaction :

    Text Solution

    |

  10. Text Solution

    |

  11. How will you account for the formation of ethane during chlorination o...

    Text Solution

    |

  12. Write the IUPAC names of the following compounds : CH3CH=C(CH3)2

    Text Solution

    |

  13. Write the IUPAC names of the following compounds : CH2=CH-C-=C-CH3

    Text Solution

    |

  14. In the alkane CH3-CH2-C(CH3)2-CH2-CH(CH3)2 identify 1^@,2^@,3^@ and 4^...

    Text Solution

    |

  15. What is the effect of branching of alkane chain on its boiling point?

    Text Solution

    |

  16. Why Wurtz reaction cannot be used to prepare pure alkanes with odd num...

    Text Solution

    |

  17. find the product of acid catalysed dehydration

    Text Solution

    |

  18. Text Solution

    |

  19. What happens when 1,3 butadiene reacts with maleic anhydride?

    Text Solution

    |

  20. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |