Home
Class 11
CHEMISTRY
Write the IUPAC names of the following c...

Write the IUPAC names of the following compounds :
`CH_3CH=C(CH_3)_2`

Promotional Banner

Topper's Solved these Questions

  • GOC-II & III

    PATHFINDER|Exercise QUESTION BANK|144 Videos

  • HYDROGEN

    PATHFINDER|Exercise QUESTION BANK|77 Videos

Similar Questions

Explore conceptually related problems

Write IUPAC names of the following compounds: CH_3CH=C(CH_3)_2

Write the IUPAC names of the following compounds : CH_2=CH-C-=C-CH_3

Write IUPAC names of the following compounds: CH_2=CH-C-=C-CH_3

Write IUPAC names of the following compounds: (ii) CH_3-C-=C-C(CH_3)_3

.Write the IUPAC name of the following compound:- CH_2 = C = CH_2

Write IUPAC names of the following compounds : (i) CH_3-C(CH_3)-underset(CH(CH_3)_2)underset(|)C=CHCH_3

Write down the IUPAC name of the following compounds : (CH_3)_2CH-NH-C_2H_5 .

Write IUPAC names of the following compounds: CH_3CH=CHCH_2CH=CHunderset(C_2H_5)underset(|)(CH)CH_2CH=CH_2

Write the IUPAC name for the following Compounds :- CH_3-CH(NO_2)- CH_2-CH (CH_3)- COOH

PATHFINDER-HYDROCARBONS-QUESTION BANK

  1. Text Solution

    |

  2. How will you account for the formation of ethane during chlorination o...

    Text Solution

    |

  3. Write the IUPAC names of the following compounds : CH3CH=C(CH3)2

    Text Solution

    |

  4. Write the IUPAC names of the following compounds : CH2=CH-C-=C-CH3

    Text Solution

    |

  5. In the alkane CH3-CH2-C(CH3)2-CH2-CH(CH3)2 identify 1^@,2^@,3^@ and 4^...

    Text Solution

    |

  6. What is the effect of branching of alkane chain on its boiling point?

    Text Solution

    |

  7. Why Wurtz reaction cannot be used to prepare pure alkanes with odd num...

    Text Solution

    |

  8. find the product of acid catalysed dehydration

    Text Solution

    |

  9. Text Solution

    |

  10. What happens when 1,3 butadiene reacts with maleic anhydride?

    Text Solution

    |

  11. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  12. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  13. Write the IUPAC names of the products obtained by the ozonolysis of th...

    Text Solution

    |

  14. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  15. An alkene 'A' upon ozonolysis gives a mixture of ethanal and pentan-3-...

    Text Solution

    |

  16. An alkene 'A' contains three C-C eight C-H and one C-C(pi) bonds upon ...

    Text Solution

    |

  17. propanal and pentan-3-one are the ozonolysis products of an alkene wha...

    Text Solution

    |

  18. Draw the cis and trans structures of hex -2 - ene. Which isomer will h...

    Text Solution

    |

  19. Addition of HBr to propene yields 2-bromopropane while in the presence...

    Text Solution

    |

  20. Write the structure of all the alkenes which upon hydrogenation give 2...

    Text Solution

    |