Home
Class 11
CHEMISTRY
Write the IUPAC names of the following c...

Write the IUPAC names of the following compounds :
`CH_2=CH-C-=C-CH_3`

Promotional Banner

Topper's Solved these Questions

  • GOC-II & III

    PATHFINDER|Exercise QUESTION BANK|144 Videos

  • HYDROGEN

    PATHFINDER|Exercise QUESTION BANK|77 Videos

Similar Questions

Explore conceptually related problems

Write IUPAC names of the following compounds: CH_2=CH-C-=C-CH_3

Write the IUPAC names of the following compounds : CH_3CH=C(CH_3)_2

Write the IUPAC names of the following compounds: H_(2)C=CH-CH-=CHand(H_(3)C)_(3)C-OH H_(3)C-underset("2-methylpropan-2-ol")underset(""^(3)CH_(3))underset(|)overset(""^(1)CH_(3))overset(|)C-OH

.Write the IUPAC name of the following compound:- CH_2 = C = CH_2

Write down the IUPAC name of the following compounds: HC-=C-CH=CH-CH_2COOC_2H_5 .

Write IUPAC names of the following compounds: CH_3CH=C(CH_3)_2

Write IUPAC names of the following compounds: (ii) CH_3-C-=C-C(CH_3)_3

Write down the IUPAC name of the following compounds : (CH_3)_2CH-NH-C_2H_5 .

Give IUPAC names of the following compounds : (i) CH_3CH_2-CH=C=CH_2

Write the IUPAC name for the following Compounds :- CH_3-CH(NO_2)- CH_2-CH (CH_3)- COOH

PATHFINDER-HYDROCARBONS-QUESTION BANK
  1. How will you account for the formation of ethane during chlorination o...

    Text Solution

    |

  2. Write the IUPAC names of the following compounds : CH3CH=C(CH3)2

    Text Solution

    |

  3. Write the IUPAC names of the following compounds : CH2=CH-C-=C-CH3

    Text Solution

    |

  4. In the alkane CH3-CH2-C(CH3)2-CH2-CH(CH3)2 identify 1^@,2^@,3^@ and 4^...

    Text Solution

    |

  5. What is the effect of branching of alkane chain on its boiling point?

    Text Solution

    |

  6. Why Wurtz reaction cannot be used to prepare pure alkanes with odd num...

    Text Solution

    |

  7. find the product of acid catalysed dehydration

    Text Solution

    |

  8. Text Solution

    |

  9. What happens when 1,3 butadiene reacts with maleic anhydride?

    Text Solution

    |

  10. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  11. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  12. Write the IUPAC names of the products obtained by the ozonolysis of th...

    Text Solution

    |

  13. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  14. An alkene 'A' upon ozonolysis gives a mixture of ethanal and pentan-3-...

    Text Solution

    |

  15. An alkene 'A' contains three C-C eight C-H and one C-C(pi) bonds upon ...

    Text Solution

    |

  16. propanal and pentan-3-one are the ozonolysis products of an alkene wha...

    Text Solution

    |

  17. Draw the cis and trans structures of hex -2 - ene. Which isomer will h...

    Text Solution

    |

  18. Addition of HBr to propene yields 2-bromopropane while in the presence...

    Text Solution

    |

  19. Write the structure of all the alkenes which upon hydrogenation give 2...

    Text Solution

    |

  20. For the following compounds write the structural formulas and IUPAC na...

    Text Solution

    |