Home
Class 11
CHEMISTRY
Why Wurtz reaction cannot be used to pre...

Why Wurtz reaction cannot be used to prepare pure alkanes with odd number carbon atoms?

Promotional Banner

Topper's Solved these Questions

  • GOC-II & III

    PATHFINDER|Exercise QUESTION BANK|144 Videos

  • HYDROGEN

    PATHFINDER|Exercise QUESTION BANK|77 Videos

Similar Questions

Explore conceptually related problems

Witting reaction is used to prepare

How would you differentiate. Why wurtz reaction is not good for synlheis of alkane containing odd number Carbon atoms? What is used in Clemmenson reduction?

Which alkane cannot be prepared by Kolbe's method ?

Why sodium metal cannot be used for drying alcohol?

Which atomic species cannot be used as a nuclear fuel ?

Wurtz reaction is suitable for the preparation of ………..alkenes.

Hydrocarbon (A) reacts with bromine by subsititution to form an alkyl bromide which by Wurtz reaction is converted to gasous hydrocarbon containing less than four carbon atoms. A is-

Hard water cannot be used in boilers -why?

PATHFINDER-HYDROCARBONS-QUESTION BANK
  1. In the alkane CH3-CH2-C(CH3)2-CH2-CH(CH3)2 identify 1^@,2^@,3^@ and 4^...

    Text Solution

    |

  2. What is the effect of branching of alkane chain on its boiling point?

    Text Solution

    |

  3. Why Wurtz reaction cannot be used to prepare pure alkanes with odd num...

    Text Solution

    |

  4. find the product of acid catalysed dehydration

    Text Solution

    |

  5. Text Solution

    |

  6. What happens when 1,3 butadiene reacts with maleic anhydride?

    Text Solution

    |

  7. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  8. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  9. Write the IUPAC names of the products obtained by the ozonolysis of th...

    Text Solution

    |

  10. Write the IUPAC names of the products obtained by thr ozonolysis of th...

    Text Solution

    |

  11. An alkene 'A' upon ozonolysis gives a mixture of ethanal and pentan-3-...

    Text Solution

    |

  12. An alkene 'A' contains three C-C eight C-H and one C-C(pi) bonds upon ...

    Text Solution

    |

  13. propanal and pentan-3-one are the ozonolysis products of an alkene wha...

    Text Solution

    |

  14. Draw the cis and trans structures of hex -2 - ene. Which isomer will h...

    Text Solution

    |

  15. Addition of HBr to propene yields 2-bromopropane while in the presence...

    Text Solution

    |

  16. Write the structure of all the alkenes which upon hydrogenation give 2...

    Text Solution

    |

  17. For the following compounds write the structural formulas and IUPAC na...

    Text Solution

    |

  18. For the following compounds write the structural formulas and IUPAC na...

    Text Solution

    |

  19. Arrange the following in increasing order of their stability.

    Text Solution

    |

  20. Write the chemical equations for the combustion of the following hydro...

    Text Solution

    |