Home
Class 11
MATHS
If tanA+tanB=a and cotA+cotB=b.Prove th...

If tanA+tanB=a and cotA+cotB=b.Prove that `cot(A+B)=1/a-1/b`

Promotional Banner

Topper's Solved these Questions

  • TRIGONOMETRIC RATIOS AND IDENTITIES

    PATHFINDER|Exercise QUESTION BANK|241 Videos

Similar Questions

Explore conceptually related problems

If tan x - tany =a " and " coty - cotx =b, "prove that", 1/a +1/b = cot (x-y).

If sin A+ tan A= a and cos A+ cot A= b, then show that (1+a)^(-2)+(1+b)^(-2)=(1-ab)^(-2)

If tanA=5/6 and tanB=1/(11) , Prove that A+B=pi/.4

If three angles A,B and C are in A,P. Prove that cotB=(sinA-sinC)/(cosC-cosA) .

If tan A = cot B, then prove that A + B = 90°.

If (1+tanA)(1+tanB)=2 , then tan(A+B)=

If tan A =cot B where A and B are acute angles prove that A+B= 90 ^(@)

In triangle A B C , if cotA *cotC=1/2a n dcot B* cotC=1/(18), then the value of tanC is

If 2costheta=a+1/a and 2 cosphi=b+1/b ,then prove that 2cos(theta-phi)=a/b+b/a

Prove log_(b)b = 1

PATHFINDER-TRIGONOMETRIC RATIOS OF COMPOUND ANGLES-QUESTIONBANK
  1. Evaluate:"sin"pi/4"cos"pi/(12)+"cos"pi/4"sin"pi/(12)

    Text Solution

    |

  2. (tan ((pi)/(4) +x))/( tan ((pi)/(4) -x ))= ((1 + tan x )/( 1- tan x ))...

    Text Solution

    |

  3. Prove that sin^2(pi/8+A/2)-sin^2(pi/8-A/2)=1/sqrt2sinA

    Text Solution

    |

  4. Find the value of tan15^@

    Text Solution

    |

  5. Prove that sin^2(n+1)A-sin^2nA=sin(2n+1)AsinA

    Text Solution

    |

  6. If tan(A+B)=x and tan(A-B)=y find the value of tan2A.

    Text Solution

    |

  7. If log(b) n = 2 and og(n) 2b = 2, then find the value of b.

    Text Solution

    |

  8. Prove that (tan69^@+tan66^@)/(1-tan69^@tan66^@)=-1.

    Text Solution

    |

  9. If tanA=5/6 and tanB=1/(11), Prove that A+B=pi/.4

    Text Solution

    |

  10. Prove that sin^2B=sin^2A+sin^2(A-B)-2sinAcosBsin(A-B)

    Text Solution

    |

  11. Prove that cos^2A+cos^2B-2cosAcosBcos(A+B)=sin^2(A+B).

    Text Solution

    |

  12. Prove that tan8theta-tan6theta-tan2theta=tan8thetatan6thetatan2theta.

    Text Solution

    |

  13. If tanA+tanB=a and cotA+cotB=b.Prove that cot(A+B)=1/a-1/b

    Text Solution

    |

  14. If tanx+tan(x+pi/3)+tan(x+(2pi)/3)=3 then prove that (3tanx-tan^3x)/(1...

    Text Solution

    |

  15. cos(beta-gamma)+cos(gamma-alpha)+cos(alpha-beta)=-3/2 show that cosalp...

    Text Solution

    |

  16. If tan(picostheta)=cot(pisintheta) Prove that sin(theta+pi/4)=1/(2sqrt...

    Text Solution

    |

  17. Let tan alpha = a/(a+1) and tan beta =1/(2a +1), then alpha + beta is:

    Text Solution

    |

  18. If theta lies in the 1st quadrant and costheta=8/(17) then prove that ...

    Text Solution

    |

  19. If alpha, beta are the solutions of the equation a tantheta+b secthet...

    Text Solution

    |

  20. Prove that tan70^(@)=2tan50^(@)+tan20^(@).

    Text Solution

    |