Home
Class 11
CHEMISTRY
For the reaction, A(g)+2B(g) hArr 2C(g),...

For the reaction, `A(g)+2B(g) hArr 2C(g)`, the rate constant for forward and the reverse reactions are `1xx10^(-4)` and `2.5xx10^(-2)` respectively. The value of equilibrium constant, K for the reaction would be

A

`2xx10^(-4)`

B

`3xx10^(-2)`

C

`4xx10^(-3)`

D

`3xx10^(2)`

Text Solution

AI Generated Solution

The correct Answer is:
To find the equilibrium constant \( K_c \) for the reaction \[ A(g) + 2B(g) \rightleftharpoons 2C(g) \] given the rate constants for the forward and reverse reactions, we can use the relationship between the equilibrium constant and the rate constants. ### Step 1: Identify the given values - Rate constant for the forward reaction, \( K_f = 1 \times 10^{-4} \) - Rate constant for the reverse reaction, \( K_b = 2.5 \times 10^{-2} \) ### Step 2: Use the formula for the equilibrium constant The equilibrium constant \( K_c \) is related to the rate constants by the formula: \[ K_c = \frac{K_f}{K_b} \] ### Step 3: Substitute the values into the formula Substituting the given values into the formula: \[ K_c = \frac{1 \times 10^{-4}}{2.5 \times 10^{-2}} \] ### Step 4: Perform the calculation To perform the division: 1. Divide the coefficients: \[ \frac{1}{2.5} = 0.4 \] 2. Subtract the exponents (since we are dividing powers of ten): \[ 10^{-4} / 10^{-2} = 10^{-4 + 2} = 10^{-2} \] Combining these results gives: \[ K_c = 0.4 \times 10^{-2} \] ### Step 5: Convert to scientific notation To express \( 0.4 \times 10^{-2} \) in proper scientific notation: \[ K_c = 4 \times 10^{-3} \] ### Final Answer Thus, the value of the equilibrium constant \( K_c \) for the reaction is: \[ K_c = 4 \times 10^{-3} \] ---

To find the equilibrium constant \( K_c \) for the reaction \[ A(g) + 2B(g) \rightleftharpoons 2C(g) \] given the rate constants for the forward and reverse reactions, we can use the relationship between the equilibrium constant and the rate constants. ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Ex 7.2|40 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Exercises (Subjective)|46 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Subjective type|1 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    CENGAGE CHEMISTRY ENGLISH|Exercise Archives Subjective|15 Videos
  • CLASSIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    CENGAGE CHEMISTRY ENGLISH|Exercise Analytical and Descriptive Type|3 Videos

Similar Questions

Explore conceptually related problems

For the reaction A+B hArr C , the rate constants for the forward and the reverse reactions are 4xx10^(2) and 2xx10^(2) respectively. The value of equilibrium constant K for the reaction would be

For the reversible reaction, A+BhArrC , the specific reaction rates for forward and reverse reactions are 1.25xx10^(3) "and" 2.75xx10^(4) respectively. The equilibrium constant for the reaction is:

For an equilibrium reaction, the rate constants for the forward and the backward reaction are 2.38xx10^(-4) and 8.15xx10^(-5) , respectively. Calculate the equilibrium constant for the reaction.

The rate constant for forward and backward reactions of hydrolysis of ester are 1.1xx10^(-2) and 1.5xx10^(-3) per minute respectively. Equilibrium constant for the reaction is

The rate constant for forward and backward reactions of hydrolysis of ester are 1.1xx10^(-2) and 1.5xx10^(-3) per minute respectively. Equilibrium constant for the reaction is

Consider the reaction A(g)+B(g) hArr C(g)+D(g) Which occurs in one step. The specific rate constant are 0.25 and 5000 for the forward and reverse reaction, respectively. The equilibrium constant is

For the reaction equilibrium, N_2O_4 (g) hArr 2NO_2 (g) the concentrations of N_2O_4 and NO_2 at equilibrium are 4.8 xx 10^(-2) and 1.2 xx 10 ^(-2) " mol " L^(-1) respectively . The value of K_c for the reaction is

The equilibrium constant for the reaction A(g)hArrB(g) and B(g)hArrC(g) are K_1=10^(-2) and K_2=10^(-1) respectively . Equilibrium constant for the reaction (1/2)C(g)hArr(1/2)A(g) is

For the reaction H_(2)(g)+I_(2)(g)hArr2HI(g) the equilibrium constant K_(p) changes with

For the reaction H_(2)(g)+I_(2)(g)hArr2HI(g) the equilibrium constant K_(p) changes with

CENGAGE CHEMISTRY ENGLISH-CHEMICAL EQUILIBRIUM-Concept Applicationexercise 7.1
  1. For a reaction NH(4)COONH(4(s))hArr2NH(3(g))+CO(2(g)), the equilibrium...

    Text Solution

    |

  2. For the reaction A+B hArr C+D, the initial concentrations of A and B a...

    Text Solution

    |

  3. 15 mol of H(2) and 5.2 moles of I(2) are mixed and allowed to attain e...

    Text Solution

    |

  4. For the reaction: 2NOCl(g) hArr 2NO(g) +Cl(2)(g), K(c) at 427^(@)C is ...

    Text Solution

    |

  5. For the reaction CuSO(4).5H(2)O(s) hArr CuSO(4).3H(2)O(s)+2H(2)O(g) ...

    Text Solution

    |

  6. Which one is the correct representation for the reaction 2SO(2)(g)+O...

    Text Solution

    |

  7. For the reactions, CO(g) +Cl2( g) hArr COCl2(g), " the " (KP)/(Kc...

    Text Solution

    |

  8. The equilibrium constant for the reacction N(2)(g)+O(2)(g)hArr2NO(g) a...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. The unit of equilibrium constant K(c) for the reaction A+B hArr C woul...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. To the system, LaCl(3)(s)+H(2)O(g) hArr LaClO(s)+2HCL(g)-"Heat" alre...

    Text Solution

    |

  13. For the reaction, A(g)+2B(g) hArr 2C(g), the rate constant for forward...

    Text Solution

    |

  14. The equilibrium constant for the reaction A(2)(g)+B(2)(g) hArr 2AB(g...

    Text Solution

    |

  15. For the reaction Ag(CN)(2)^(ɵ)hArr Ag^(o+)+2CN^(ɵ), the K(c ) at 25^...

    Text Solution

    |

  16. At a certain temperature, the equilibrium constant (K(c )) is 16 for t...

    Text Solution

    |

  17. HI was heated in a sealed tube at 400^(@)C till the equilibrium was re...

    Text Solution

    |

  18. For the equilibrium AB(g) hArr A(g)+B(g) at a given temperature, the p...

    Text Solution

    |

  19. For a reversible reaction, if the concentration of the reactants are d...

    Text Solution

    |

  20. For the equilibrium AB(g) hArr A(g) +B(g), K(p) is equal to four t...

    Text Solution

    |