Home
Class 11
CHEMISTRY
The equilibrium constant for the reactio...

The equilibrium constant for the reaction
`A_(2)(g)+B_(2)(g) hArr 2AB(g)`
is `20` at `500K`. The equilibrium constant for the reaction `2AB(g) hArr A_(2)(g)+B_(2)(g)` would be

A

`20`

B

`0.5`

C

`0.05`

D

`10`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we need to determine the equilibrium constant for the reverse reaction given the equilibrium constant for the forward reaction. ### Step-by-Step Solution: 1. **Identify the given reaction and its equilibrium constant**: The forward reaction is: \[ A_2(g) + B_2(g) \rightleftharpoons 2AB(g) \] The equilibrium constant for this reaction, denoted as \( K_1 \), is given as \( 20 \) at \( 500K \). 2. **Write the reverse reaction**: The reverse reaction is: \[ 2AB(g) \rightleftharpoons A_2(g) + B_2(g) \] We need to find the equilibrium constant for this reaction, which we will denote as \( K_2 \). 3. **Relate the equilibrium constants**: The equilibrium constant for a reaction is related to the equilibrium constant of its reverse reaction. Specifically, if you reverse a reaction, the equilibrium constant for the reverse reaction is the reciprocal of the equilibrium constant for the forward reaction: \[ K_2 = \frac{1}{K_1} \] 4. **Substitute the known value of \( K_1 \)**: Since \( K_1 = 20 \): \[ K_2 = \frac{1}{20} \] 5. **Calculate \( K_2 \)**: Performing the calculation gives: \[ K_2 = 0.05 \] ### Conclusion: The equilibrium constant for the reaction \( 2AB(g) \rightleftharpoons A_2(g) + B_2(g) \) is \( 0.05 \).

To solve the problem, we need to determine the equilibrium constant for the reverse reaction given the equilibrium constant for the forward reaction. ### Step-by-Step Solution: 1. **Identify the given reaction and its equilibrium constant**: The forward reaction is: \[ A_2(g) + B_2(g) \rightleftharpoons 2AB(g) ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Ex 7.2|40 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Exercises (Subjective)|46 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Subjective type|1 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    CENGAGE CHEMISTRY ENGLISH|Exercise Archives Subjective|15 Videos
  • CLASSIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    CENGAGE CHEMISTRY ENGLISH|Exercise Analytical and Descriptive Type|3 Videos

Similar Questions

Explore conceptually related problems

The equilibrium constant K_(p) for the reaction H_(2)(g)+I_(2)(g) hArr 2HI(g) changes if:

The equilibrium constant for the given reaction is 100. N_(2)(g)+2O_(2)(g) hArr 2NO_(2)(g) What is the equilibrium constant for the reaction ? NO_(2)(g) hArr 1//2 N_(2)(g) +O_(2)(g)

The value of the equilibrium constant for the reaction : H_(2) (g) +I_(2) (g) hArr 2HI (g) at 720 K is 48. What is the value of the equilibrium constant for the reaction : 1//2 H_(2)(g) + 1//2I_(2)(g) hArr HI (g)

Unit of equilibrium constant K_p for the reaction PCl_5(g) hArr PCl_3(g)+ Cl_2(g) is

The equilibrium constant of the reaction SO_(2)(g) + 1//2O_(2)(g)hArrSO_(3)(g) is 4xx10^(-3)atm^(-1//2) . The equilibrium constant of the reaction 2SO_(3)(g)hArr2SO_(2)(g) + O_(2)(g) would be:

The value of equilibrium constant for the reaction [N_2O_5 (g) hArr 2NO_2(g) + 1/2 O_2(g)] is 0.5. The equilibruim constant for the reaction [4NO_2(g) + O_2(g) hArr 2N_2O_5(g)] is

The equilibrium constant for the reaction N_(2)(g)+O_(2)(g) hArr 2NO(g) at temperature T is 4xx10^(-4) . The value of K_(c) for the reaction NO(g) hArr 1/2 N_(2)(g)+1/2 O_(2)(g) at the same temperature is

The equilibrium constant for the reaction N_(2)(g)+O_(2)(g) hArr 2NO(g) at temperature T is 4xx10^(-4) . The value of K_(c) for the reaction NO(g) hArr 1/2 N_(2)(g)+1/2 O_(2)(g) at the same temperature is

The equilibrium constant for the reaction N_(2)(g)+O_(2)(g) hArr 2NO(g) at temperature T is 4xx10^(-4) . The value of K_(c) for the reaction NO(g) hArr 1/2 N_(2)(g)+1/2 O_(2)(g) at the same temperature is

The equilibrium constant for the reaction N_(2)(g)+O_(2)(g) hArr 2NO(g) at temperature T is 4xx10^(-4) . The value of K_(c) for the reaction NO(g) hArr 1/2 N_(2)(g)+1/2 O_(2)(g) at the same temperature is

CENGAGE CHEMISTRY ENGLISH-CHEMICAL EQUILIBRIUM-Concept Applicationexercise 7.1
  1. For a reaction NH(4)COONH(4(s))hArr2NH(3(g))+CO(2(g)), the equilibrium...

    Text Solution

    |

  2. For the reaction A+B hArr C+D, the initial concentrations of A and B a...

    Text Solution

    |

  3. 15 mol of H(2) and 5.2 moles of I(2) are mixed and allowed to attain e...

    Text Solution

    |

  4. For the reaction: 2NOCl(g) hArr 2NO(g) +Cl(2)(g), K(c) at 427^(@)C is ...

    Text Solution

    |

  5. For the reaction CuSO(4).5H(2)O(s) hArr CuSO(4).3H(2)O(s)+2H(2)O(g) ...

    Text Solution

    |

  6. Which one is the correct representation for the reaction 2SO(2)(g)+O...

    Text Solution

    |

  7. For the reactions, CO(g) +Cl2( g) hArr COCl2(g), " the " (KP)/(Kc...

    Text Solution

    |

  8. The equilibrium constant for the reacction N(2)(g)+O(2)(g)hArr2NO(g) a...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. The unit of equilibrium constant K(c) for the reaction A+B hArr C woul...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. To the system, LaCl(3)(s)+H(2)O(g) hArr LaClO(s)+2HCL(g)-"Heat" alre...

    Text Solution

    |

  13. For the reaction, A(g)+2B(g) hArr 2C(g), the rate constant for forward...

    Text Solution

    |

  14. The equilibrium constant for the reaction A(2)(g)+B(2)(g) hArr 2AB(g...

    Text Solution

    |

  15. For the reaction Ag(CN)(2)^(ɵ)hArr Ag^(o+)+2CN^(ɵ), the K(c ) at 25^...

    Text Solution

    |

  16. At a certain temperature, the equilibrium constant (K(c )) is 16 for t...

    Text Solution

    |

  17. HI was heated in a sealed tube at 400^(@)C till the equilibrium was re...

    Text Solution

    |

  18. For the equilibrium AB(g) hArr A(g)+B(g) at a given temperature, the p...

    Text Solution

    |

  19. For a reversible reaction, if the concentration of the reactants are d...

    Text Solution

    |

  20. For the equilibrium AB(g) hArr A(g) +B(g), K(p) is equal to four t...

    Text Solution

    |