Home
Class 11
CHEMISTRY
At a certain temperature, the equilibriu...

At a certain temperature, the equilibrium constant `(K_(c ))` is `16` for the reaction:
`SO_(2)(g)+NO_(2)(g)hArrSO_(3)(g)+NO(g)`
If we take one mole of each of the four gases in one litre container then what will be the equilibrium concentration of `NO` and `NO_(2)`?

A

`1.6 mol L^(-1)`

B

`0.8 mol L^(-1)`

C

`0.4 mol L^(-1)`

D

`0.6 mol L^(-1)`

Text Solution

Verified by Experts

The correct Answer is:
C

`{:(SO_(2)(g),+,NO_(2)(g),hArr,SO_(3)(g),+,NO(g),),(1,,1,,1,,1,"Initial conc"),(1-x,,1-x,,1+x,,1+x,"At Eq."):}`
`K=([SO_(3)][NO])/([SO_(2)][NO_(2)])=((1+x)(1+x))/((1-x)(1-x))`
`16=((1+x)^(2))/((1-x)^(2))rArr((1+x))/((1-x))=4` or `x=0.6`
`[NO_(2)]=1-x=1-0.6=0.4 "mol" L^(-1)`
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Ex 7.2|40 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Exercises (Subjective)|46 Videos
  • CHEMICAL EQUILIBRIUM

    CENGAGE CHEMISTRY ENGLISH|Exercise Subjective type|1 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    CENGAGE CHEMISTRY ENGLISH|Exercise Archives Subjective|15 Videos
  • CLASSIFICATION AND NOMENCLATURE OF ORGANIC COMPOUNDS

    CENGAGE CHEMISTRY ENGLISH|Exercise Analytical and Descriptive Type|3 Videos

Similar Questions

Explore conceptually related problems

At a certain temperature, equilibrium constant (K_(c)) is 16 for the reaction: SO_(2)(g)+NO_(2)(g) hArr SO_(3)(g)+NO(g) If we take 1 mol of each of the four gases in a 1L container, what would be the equilibrium concentrations of NO and NO_(2) ?

At a certain temperature, the equilibrium constant (K_(c )) is 16 for the reaction: SO_(2)(g)+NO_(2)(g)hArrSO_(3)(g)+NO(g) If we take one mole of each of the equilibrium concentration of NO and NO_(2) ?

At a certain temperature , the equilibrium constant (K_(c)) is 4//9 for the reaction : CO(g)+H_(2)O(g) hArr CO_(2)(g)+H_(2)(g) If we take 10 mole of each of the four gases in a one - litre container, what would be the equilibrium mole percent of H_(2)(g) ?

At a certain temperature the equilibrium constant K_(c) is 0.25 for the reaction A_(2)(g)+B_(2)(g)hArrC_(2)(g)+D_(2)(g) If we take 1 mole of each of the four gases in a 10 litre container ,what would be equilibrium concentration of A_(2) (g)?

At a certain temperature, the equilibrium constant K_(c) is 16 for the reaction, SO_((g))+NO_(2(g))hArrSO_(3(g))+NO_((g)) If 1.0 mol each of the four gases is taken in a one litre container the concentration of NO_(2) at equilibrium would is

At a certain temperature and 2 atm pressure equilibrium constant (K_(p)) is 25 for the reaction SO_(2)(g)+NO_(2)(g)hArrSO_(3)(g)+NO(g) Initially if we take 2 moles of each of the four gases and 2 moles of inert gas, what would be the equilibrium partial pressure of NO_(2) ?

The equilibrium constant K_(p) for the reaction H_(2)(g)+I_(2)(g) hArr 2HI(g) changes if:

The equilibrium K_(c) for the reaction SO_(2)(g)NO_(2)(g)hArrSO_(3)(g)+NO(g)is 16 1 mole of rach of all the four gases is taken in 1dm^(3) vessel , the equilibrium concentration of NO would be:

The equilibrium K_(c) for the reaction SO_(2)(g)NO_(2)(g)hArrSO_(3)(g)+NO(g)is 16 1 mole of rach of all the four gases is taken in 1dm^(3) vessel , the equilibrium concentration of NO would be:

The equilibrium constant for the reaction N_(2)(g)+3H_(2)(g)hArrNH_(3)(g) is K' K and K' will be related to each other as

CENGAGE CHEMISTRY ENGLISH-CHEMICAL EQUILIBRIUM-Concept Applicationexercise 7.1
  1. For a reaction NH(4)COONH(4(s))hArr2NH(3(g))+CO(2(g)), the equilibrium...

    Text Solution

    |

  2. For the reaction A+B hArr C+D, the initial concentrations of A and B a...

    Text Solution

    |

  3. 15 mol of H(2) and 5.2 moles of I(2) are mixed and allowed to attain e...

    Text Solution

    |

  4. For the reaction: 2NOCl(g) hArr 2NO(g) +Cl(2)(g), K(c) at 427^(@)C is ...

    Text Solution

    |

  5. For the reaction CuSO(4).5H(2)O(s) hArr CuSO(4).3H(2)O(s)+2H(2)O(g) ...

    Text Solution

    |

  6. Which one is the correct representation for the reaction 2SO(2)(g)+O...

    Text Solution

    |

  7. For the reactions, CO(g) +Cl2( g) hArr COCl2(g), " the " (KP)/(Kc...

    Text Solution

    |

  8. The equilibrium constant for the reacction N(2)(g)+O(2)(g)hArr2NO(g) a...

    Text Solution

    |

  9. K(p)//K(c) for the reaction CO(g)+1/2 O(2)(g) hArr CO(2)(g) is

    Text Solution

    |

  10. The unit of equilibrium constant K(c) for the reaction A+B hArr C woul...

    Text Solution

    |

  11. For which of the following reaction does the equilibrium constant depe...

    Text Solution

    |

  12. To the system, LaCl(3)(s)+H(2)O(g) hArr LaClO(s)+2HCL(g)-"Heat" alre...

    Text Solution

    |

  13. For the reaction, A(g)+2B(g) hArr 2C(g), the rate constant for forward...

    Text Solution

    |

  14. The equilibrium constant for the reaction A(2)(g)+B(2)(g) hArr 2AB(g...

    Text Solution

    |

  15. For the reaction Ag(CN)(2)^(ɵ)hArr Ag^(o+)+2CN^(ɵ), the K(c ) at 25^...

    Text Solution

    |

  16. At a certain temperature, the equilibrium constant (K(c )) is 16 for t...

    Text Solution

    |

  17. HI was heated in a sealed tube at 400^(@)C till the equilibrium was re...

    Text Solution

    |

  18. For the equilibrium AB(g) hArr A(g)+B(g) at a given temperature, the p...

    Text Solution

    |

  19. For a reversible reaction, if the concentration of the reactants are d...

    Text Solution

    |

  20. For the equilibrium AB(g) hArr A(g) +B(g), K(p) is equal to four t...

    Text Solution

    |