Write the common name of the given compound.
`CH_(3)-underset(CH_(3))underset(|)overset(CH_(3))overset(|)(C)-CH_(2)-CH_(2)-CH_(3)`

Explanation

To find the common name of the given compound, we will follow these steps:

### Step 1: Identify the Structure
The compound is represented as `CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH3`. This indicates that there are three methyl groups attached to a longer carbon chain.

### Step 2: Determine the Longest Carbon Chain
The longest continuous carbon chain in the compound consists of five carbon atoms. This is the backbone of the molecule.

...