Home
Class 10
CHEMISTRY
H(2)(g)+I(2)harr2HI+Heat answer the fo...

`H_(2)(g)+I_(2)harr2HI+Heat`
answer the following questions related to the given system at equlibrium.
a) The rate of which reactions increases when the concentration of `I_(2)` is increased?
b) What is the influence of pressure on this system?
c) `HI` must be kept at low temperature to prevent its decomposition. Give reason.

Promotional Banner

Topper's Solved these Questions

  • CHEMICAL NAME OF ORGANIC COMPOUNDS

    V PUBLICATION|Exercise QUESTION BANK|60 Videos

  • GAS LAWS AND MOLE CONCEPT

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

H_(2)(g)+I_(2)hArr2HI(g) Which of the following has no effect on the given system at equlibrium. ( Temperature, Pressure, Concentration).

H_2(g)+I_2(g)harr2HI(g)+Heat How do the following circumstances influence the reaction: Increase the temperature.

2HI(g)hArrH_(2)+I_(2)(g) Which of the following does not influence the above system at equlibrium? Give reason. i) Increase the concentration of reactant ii) Add more hydrogen iii) Increase the temperature iv) Increase the pressure

H_2(g)+I_2(g)harr2HI(g) What is the total number of moles of reactants?

H_2(g)+I_2(g)harr2HI(g)+Heat How do the following circumstances influence the reaction: Increase the concentration of H_2 .

The conversion of molecule A to B follows second order kinetics its rate equation for the second order reaction is rate = K[A]^2.If the concentration of A is increased to 4 times how will it affect the formation of B.

Rate of a reaction is the change in concentration of any one of the reactants or any one of the products in unit time. 2HI to H_(2)+I_(2) Whether the molecularity and the order of the above reaction are the same? Give reason.

Analyse the system at equlibrium given below. 2CO(g)+O_(2)harr2CO_(2)(g) a) What are the reactants here? b) what will happen to the system when the amount of oxygen is increased? c) How does the increase in presssure affect the forward reaction?

N_2(g)+3H_2(g)harr2NH_3(g)+heat : What is the change in conce-natration required for increasing the rate of the forward reaction?

H_2(g)+I_2(g)harr2HI(g)+Heat How certain circumstances like P,T,V,C influence the reaction: Identify the law related to it. State it.

V PUBLICATION-COMPOUNDS OF NON -METALS-QUESTION BANK
  1. Write an identification test for sulphur salts.

    Text Solution

    |

  2. Take some sugar in a dry test tube and add a few drops of concentrated...

    Text Solution

    |

  3. Arrange the following reactions in correct order. i) SO(3)+H(2)SO(4...

    Text Solution

    |

  4. a) Write the equation of the preparation of ammonia. b) What is th...

    Text Solution

    |

  5. Explain the following with suitable examples a) Reversible reaction...

    Text Solution

    |

  6. Write the products and complete the reactions i) H(2)SO(4)+2NaOH ....

    Text Solution

    |

  7. Which of the following does not effect a chemical reaction in equlibri...

    Text Solution

    |

  8. Which acid is known as 'King of chemicals?

    Text Solution

    |

  9. Example of basic drying agent is…..

    Text Solution

    |

  10. It is not advisable to pour water into sulphuric acid, while diluting ...

    Text Solution

    |

  11. H(2)(g)+I(2)hArr2HI(g) Which of the following has no effect on the giv...

    Text Solution

    |

  12. A system at equlibrium is given below. N(2)(g)+3H(2)hArr2NH(3)+Heat ...

    Text Solution

    |

  13. NaCl+H(2)SO(4)rarrNaHSO(4)+HCl a) In the above reaction, NaCl reac...

    Text Solution

    |

  14. The glassCl(2),SO(2) and HCl are passed through H(2)SO(4)during their ...

    Text Solution

    |

  15. 2HI(g)hArrH(2)+I(2)(g) Which of the following does not influence th...

    Text Solution

    |

  16. 2SO(2)+O(2)harr 2SO(3)+Heat what is the influence of concentration, pr...

    Text Solution

    |

  17. H(2)(g)+I(2)harr2HI+Heat answer the following questions related to t...

    Text Solution

    |

  18. Some of the uses of chemicals are given below. List and classify them ...

    Text Solution

    |

  19. A,B and C are three gases (Symbols are nor real) Suppose 1 mole a reac...

    Text Solution

    |

  20. Analyse the system at equlibrium given below. 2CO(g)+O(2)harr2CO(2)(g)...

    Text Solution

    |