A,B and C are three gases (Symbols are n...

A,B and C are three gases (Symbols are nor real) Suppose 1 mole a react with 1 mole B to form 2 mole C. This is a reversible reaction.
a) Write the chemical equation for the above reaction.
b) What is the effect of pressure on this system?
c) What will happen when more amount of 'A' is added to the system at equlibrium?
d) What will happen if the amount of 'C' is increased?

Text Solution

Verified by Experts

a) `A+Bharr2C`
b) Pressure has no effect
c) rate of forward reaction increases and get more product.
d) rate of backward reaction increases

Topper's Solved these Questions

CHEMICAL NAME OF ORGANIC COMPOUNDS
V PUBLICATION|Exercise QUESTION BANK|60 Videos
GAS LAWS AND MOLE CONCEPT
V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

What happens when the pressure of system is decreased?

A,B,C and D are four gases. 2 mole A react with 3 mole B to form 2 mole C and mole D. in this reversible reaction, forward reaction is exothermic. Write the chemical equation for the reaction and answer thefollowing questions. a) If the system is at eqilibrium, what will be the effect of increase in pressure on the system? b) What is the effect of change in temperature?

When bromoethane is reacted with sodium in the presence of ether an alkane is formed.Give the chemical equation for the above reaction.

What happens when acidified KMnO_4 solution reacts with aqueous Kl solution? Give the chemical equation for the reaction.

Write the van der Waal's equation for 'n' moles of a real gas.

Sodium chloride solution is electrolysed using platinum electrodes. a) Write the chemical equation of the reaction at cathode. b) What happens when phenolphthalein is added to the solution? State the reason?

The reaction A+2 B rarr C obeys the rate equation rate=k[A]^0.5[B]^1.5 what is the order of the reaction?

A+B+Heatharr2C+D This reversible reaction is in equlibrium. What happens to the amount of products under the following conditions: C is removed from the system.

V PUBLICATION-COMPOUNDS OF NON -METALS-QUESTION BANK

Write an identification test for sulphur salts.
Text Solution
|
Take some sugar in a dry test tube and add a few drops of concentrated...
Text Solution
|
Arrange the following reactions in correct order. i) SO(3)+H(2)SO(4...
Text Solution
|
a) Write the equation of the preparation of ammonia. b) What is th...
Text Solution
|
Explain the following with suitable examples a) Reversible reaction...
Text Solution
|
Write the products and complete the reactions i) H(2)SO(4)+2NaOH ....
Text Solution
|
Which of the following does not effect a chemical reaction in equlibri...
Text Solution
|
Which acid is known as 'King of chemicals?
Text Solution
|
Example of basic drying agent is…..
Text Solution
|
It is not advisable to pour water into sulphuric acid, while diluting ...
Text Solution
|
H(2)(g)+I(2)hArr2HI(g) Which of the following has no effect on the giv...
Text Solution
|
A system at equlibrium is given below. N(2)(g)+3H(2)hArr2NH(3)+Heat ...
Text Solution
|
NaCl+H(2)SO(4)rarrNaHSO(4)+HCl a) In the above reaction, NaCl reac...
Text Solution
|
The glassCl(2),SO(2) and HCl are passed through H(2)SO(4)during their ...
Text Solution
|
2HI(g)hArrH(2)+I(2)(g) Which of the following does not influence th...
Text Solution
|
2SO(2)+O(2)harr 2SO(3)+Heat what is the influence of concentration, pr...
Text Solution
|
H(2)(g)+I(2)harr2HI+Heat answer the following questions related to t...
Text Solution
|
Some of the uses of chemicals are given below. List and classify them ...
Text Solution
|
A,B and C are three gases (Symbols are nor real) Suppose 1 mole a reac...
Text Solution
|
Analyse the system at equlibrium given below. 2CO(g)+O(2)harr2CO(2)(g)...
Text Solution
|