Home
Class 10
CHEMISTRY
Analyse the system at equlibrium given b...

Analyse the system at equlibrium given below. `2CO(g)+O_(2)harr2CO_(2)(g)`
a) What are the reactants here?
b) what will happen to the system when the amount of oxygen is increased?
c) How does the increase in presssure affect the forward reaction?

Text Solution

Verified by Experts

a) `CO, O_(2)`
b) According to Le-chateller.s principle when the concentration of the reactant oxygen is increased the systen willvreadjust itself and as a result the rate of forward reaction increases and more product will be formed
c) The rate of forward reaction increases.
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL NAME OF ORGANIC COMPOUNDS

    V PUBLICATION|Exercise QUESTION BANK|60 Videos

  • GAS LAWS AND MOLE CONCEPT

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

A system at equlibrium is given below. N_(2)O_(4)hArr2NO_(2)(g) write any two conditions which favour the formation of NO_(2) gas .

2NO(g)+O_2(g)harr2NO_2(g)+heat In this reaction how do the following changes influence the amount of the product: Increase in pressure

A system at equlibrium is given below. N_(2)(g)+3H_(2)hArr2NH_(3)+Heat a) When does a reversible process attain equlibrium? b) What change occurs in the concentration of reactants and products in a system at equlibrium?

2NO(g)+O_2(g)harr2NO_2(g)+heat In this reaction how do the following changes influence the amount of the product: Increase in concentration of oxygen.

2NO(g)+O_2(g)harr2NO_2(g)+heat In this reaction how do the following changes influence the amount of the product: Decrease in temperature

2NO(g)+O_(2)Leftrightarrow2NO_(2)(g)+Heat in this reaction how do the following changes influence the amount of the product? a) Decrease in temperature b) Increase in pressure c) Increase in concentration of oxygen

Pressure has no influence in the following equilibrium: N_2(g)+O_2(g)harr2NO_(g) . What is the reason for this?

2NO_2(g) harr N_2O_4(g): DeltaH =-52.7 kJmol_1 What change will happen if we increase the temperature?

N_2(g)+3H_2(g)harr2NH_3(g)+heat : What is the change in conce-natration required for increasing the rate of the forward reaction?

H_(2)(g)+I_(2)harr2HI+Heat answer the following questions related to the given system at equlibrium. a) The rate of which reactions increases when the concentration of I_(2) is increased? b) What is the influence of pressure on this system? c) HI must be kept at low temperature to prevent its decomposition. Give reason.

V PUBLICATION-COMPOUNDS OF NON -METALS-QUESTION BANK
  1. Write an identification test for sulphur salts.

    Text Solution

    |

  2. Take some sugar in a dry test tube and add a few drops of concentrated...

    Text Solution

    |

  3. Arrange the following reactions in correct order. i) SO(3)+H(2)SO(4...

    Text Solution

    |

  4. a) Write the equation of the preparation of ammonia. b) What is th...

    Text Solution

    |

  5. Explain the following with suitable examples a) Reversible reaction...

    Text Solution

    |

  6. Write the products and complete the reactions i) H(2)SO(4)+2NaOH ....

    Text Solution

    |

  7. Which of the following does not effect a chemical reaction in equlibri...

    Text Solution

    |

  8. Which acid is known as 'King of chemicals?

    Text Solution

    |

  9. Example of basic drying agent is…..

    Text Solution

    |

  10. It is not advisable to pour water into sulphuric acid, while diluting ...

    Text Solution

    |

  11. H(2)(g)+I(2)hArr2HI(g) Which of the following has no effect on the giv...

    Text Solution

    |

  12. A system at equlibrium is given below. N(2)(g)+3H(2)hArr2NH(3)+Heat ...

    Text Solution

    |

  13. NaCl+H(2)SO(4)rarrNaHSO(4)+HCl a) In the above reaction, NaCl reac...

    Text Solution

    |

  14. The glassCl(2),SO(2) and HCl are passed through H(2)SO(4)during their ...

    Text Solution

    |

  15. 2HI(g)hArrH(2)+I(2)(g) Which of the following does not influence th...

    Text Solution

    |

  16. 2SO(2)+O(2)harr 2SO(3)+Heat what is the influence of concentration, pr...

    Text Solution

    |

  17. H(2)(g)+I(2)harr2HI+Heat answer the following questions related to t...

    Text Solution

    |

  18. Some of the uses of chemicals are given below. List and classify them ...

    Text Solution

    |

  19. A,B and C are three gases (Symbols are nor real) Suppose 1 mole a reac...

    Text Solution

    |

  20. Analyse the system at equlibrium given below. 2CO(g)+O(2)harr2CO(2)(g)...

    Text Solution

    |