Home
Class 10
CHEMISTRY
CH-=CH+O(2)rarr.....+.........

`CH-=CH+O_(2)rarr.....+......`

Text Solution

Verified by Experts

`CO_(2)+H_(2)O`
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

Complete the equation fot the following chemical reaction. Name this reaction. CH_(3)CH_(2)CH_(2)CH_(3)+O_(2)rarr........+....

Write the products formed in the following addition reactions. a) CH_(2)=CH_(2)+HClrarr...... b) CH-=CH+2H_(2)rarr......

Consider the reaction : CH_(3)CH_(2)Cl overset(KCN)rarrX overset(Ni//H_(2))rarr Y overset((CH_(3)CO)_(2)O)rarr Z . Z is

By Oxo-process (CH_3)_2C=CH_2+CO+H_2 rarr A . A formed is

The equation of some reaction are given below. nCH_2=CH_2rarr(CH_2-CH_2)_n , CH_2-COOH+CH_3-CH_2-OHrarrCH_3-COOCH_2CH_3+H_2O : Write the name of the above reactions.

The equation of some reaction are given below. nCH_2=CH_2rarr(CH_2-CH_2)_n , CH_3-COOH+CH_3-CH_2-OHrarrCH_3-COOCH_2CH_3+H_2O : Write the name of product obtained in the second reaction (IUPAC name)

Identify the product/s in the following reaction 3CH_(3)CH=CH_(2)overset(BH_(3))rarrXoverset(H_(2)O_(2)//OH^(-))rarr" Product/s "+H_(3)BO_(3)

The reaction CH_3CH_2l + KOH (aq) rarr CH_3 CH_2OH + Kl is classified as

Consider the reaction given below: CH_3-CH = CH_2+HBr rarr CH_3-CH(Br)-CH_3+CH_3-CH_2-CH_2Br Identify the major product obtained.

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. Find out the odd one (P.V.C. Polythene, bakelite, Methanol)

    Text Solution

    |

  2. 8-10% strong ethanol is known as…...

    Text Solution

    |

  3. CH-=CH+O(2)rarr.....+......

    Text Solution

    |

  4. Methanol added ethanol is called

    Text Solution

    |

  5. The chief component of LPG is

    Text Solution

    |

  6. The mixture of absolute alcohol and petrol is known as

    Text Solution

    |

  7. Name the polymer which is used in the interior coating of nonstick coo...

    Text Solution

    |

  8. The functional group present in organic acid is

    Text Solution

    |

  9. Choose the suitable compounds from those given in brackets to make it ...

    Text Solution

    |

  10. Analyse the given reaction and answer the following questions. a) I...

    Text Solution

    |

  11. The equation of a chemical reaction is given below. a. To which typ...

    Text Solution

    |

  12. A+BrarrEthyl ethanoate + water a) Identify A and B b) Write the...

    Text Solution

    |

  13. Write down the products of the combustion of the following hydrocarbon...

    Text Solution

    |

  14. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  15. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  16. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  17. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  18. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  19. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  20. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |