Home
Class 10
CHEMISTRY
Choose the suitable compounds from those...

Choose the suitable compounds from those given in brackets to make it undergo the following reaction. (`CH_(4)`, `C_(2)H_(4)`, `C_(8)H_(18)` , `CH_(3)Cl` a. Thermal cracking b. Polymerisation

Text Solution

Verified by Experts

a) `C_(8)H_(18)` b) `C_(2)H_(4)`
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

The precuts formed in the following reaction are C_(6)H_(5)- O-CH_(3) + HI overset(heat)rarr

Give the IUPAC names of the following compounds: CH_3C(p-CIC_6H_4)_2CH(Br)CH_3 .

Choose the correct answer from the brackets given below: 3) Find the odd man out. Give reason ( C_2H_4 , C_3H_6 , C_4H_8 , C_2H_6 )

Of the given compounds the name of which one ends with 'yne'? C_(3)H_(6) C_(3)H_(4) C_(4)H_(8) C_(4)H_(10)

What is the major product of the following reaction? CH_3 C equiv C-CH_2 CH_3 + 1moleof Cl_2 rarr

Identify the isomerism exhibited by the following compounds. CH_3(CH_2)_3 CH_3 and (CH_3)_4C

Among the following compounds, strongest acid is? : HC≡CH , C_6 H_6 , C_2 H_6 , CH_3 OH

Give the IUPAC names of the following compounds: (CH_3)_3C CH = C CIC_6H_4l-p .,

Indicate the sigma and pi bonds in the following molecules C_6H_6 , C_6H_12 , CH_2Cl_2 , CH_2 = C = CH_2

Which of the following graphs is correct for the following reaction? Ch_(3)-CH_(2)-CH=CH_(2) underset(300^(@)C)overset(H_(2)//Ni)rarrCH_(3)-CH-CH_(2)-CH_(3)

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. Name the polymer which is used in the interior coating of nonstick coo...

    Text Solution

    |

  2. The functional group present in organic acid is

    Text Solution

    |

  3. Choose the suitable compounds from those given in brackets to make it ...

    Text Solution

    |

  4. Analyse the given reaction and answer the following questions. a) I...

    Text Solution

    |

  5. The equation of a chemical reaction is given below. a. To which typ...

    Text Solution

    |

  6. A+BrarrEthyl ethanoate + water a) Identify A and B b) Write the...

    Text Solution

    |

  7. Write down the products of the combustion of the following hydrocarbon...

    Text Solution

    |

  8. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  9. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  10. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  11. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  12. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  13. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  14. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  15. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  16. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  17. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  18. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  19. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  20. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |